C21H20Cl2FN5O — CID 147977020
3-(3,5-dichlorophenyl)-5-[2-(2-fluoro-6-methyl-4-pyridinyl)-2,8-diazaspiro[3.5]nonan-8-yl]-1,2,4-oxadiazole (PubChem CID 147977020) has the molecular formula C21H20Cl2FN5O and a molecular weight of 448.33 g/mol. Its IUPAC name is 3-(3,5-dichlorophenyl)-5-[2-(2-fluoro-6-methyl-4-pyridinyl)-2,8-diazaspiro[3.5]nonan-8-yl]-1,2,4-oxadiazole.
| Compound Name | 3-(3,5-dichlorophenyl)-5-[2-(2-fluoro-6-methyl-4-pyridinyl)-2,8-diazaspiro[3.5]nonan-8-yl]-1,2,4-oxadiazole |
|---|---|
| PubChem CID | 147977020 |
| Molecular Formula | C21H20Cl2FN5O |
| Molecular Weight | 448.33 g/mol |
| Exact Mass | 447.10 |
| IUPAC Name | 3-(3,5-dichlorophenyl)-5-[2-(2-fluoro-6-methyl-4-pyridinyl)-2,8-diazaspiro[3.5]nonan-8-yl]-1,2,4-oxadiazole |
| SMILES | Cc1cc(N2CC3(CCCN(c4nc(-c5cc(Cl)cc(Cl)c5)no4)C3)C2)cc(F)n1 |
| InChI | InChI=1S/C21H20Cl2FN5O/c1-13-5-17(9-18(24)25-13)29-11-21(12-29)3-2-4-28(10-21)20-26-19(27-30-20)14-6-15(22)8-16(23)7-14/h5-9H,2-4,10-12H2,1H3 |
| InChIKey | ISMGTVRWDAJGLM-UHFFFAOYSA-N |
| XLogP | 4.99 |
| TPSA | 58.29 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 30 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 448.33 |
| LogP ≤ 5 | 4.99 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': '2-halo_pyridine', 'substructure': 'N/A'} |
|---|