C14H11NO2S2 — CID 1479777
4-benzoyl-2,3-dihydrothieno[3,2-f][1,4]thiazepin-5-one (PubChem CID 1479777) has the molecular formula C14H11NO2S2 and a molecular weight of 289.38 g/mol. Its IUPAC name is 4-benzoyl-2,3-dihydrothieno[3,2-f][1,4]thiazepin-5-one.
| Compound Name | 4-benzoyl-2,3-dihydrothieno[3,2-f][1,4]thiazepin-5-one |
|---|---|
| PubChem CID | 1479777 |
| Molecular Formula | C14H11NO2S2 |
| Molecular Weight | 289.38 g/mol |
| Exact Mass | 289.02 |
| IUPAC Name | 4-benzoyl-2,3-dihydrothieno[3,2-f][1,4]thiazepin-5-one |
| SMILES | O=C(c1ccccc1)N1CCSc2sccc2C1=O |
| InChI | InChI=1S/C14H11NO2S2/c16-12(10-4-2-1-3-5-10)15-7-9-19-14-11(13(15)17)6-8-18-14/h1-6,8H,7,9H2 |
| InChIKey | HIDVSNSFUZYINN-UHFFFAOYSA-N |
| XLogP | 3.14 |
| TPSA | 37.38 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 289.38 |
| LogP ≤ 5 | 3.14 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'phthalimide', 'substructure': 'N/A'} |
|---|