C21H25N5O — CID 147980565
5-(1-methylcyclopropyl)oxy-3-[6-(4-methylpiperazin-1-yl)pyrimidin-4-yl]-1H-isoindole (PubChem CID 147980565) has the molecular formula C21H25N5O and a molecular weight of 363.47 g/mol. Its IUPAC name is 5-(1-methylcyclopropyl)oxy-3-[6-(4-methylpiperazin-1-yl)pyrimidin-4-yl]-1H-isoindole.
| Compound Name | 5-(1-methylcyclopropyl)oxy-3-[6-(4-methylpiperazin-1-yl)pyrimidin-4-yl]-1H-isoindole |
|---|---|
| PubChem CID | 147980565 |
| Molecular Formula | C21H25N5O |
| Molecular Weight | 363.47 g/mol |
| Exact Mass | 363.21 |
| IUPAC Name | 5-(1-methylcyclopropyl)oxy-3-[6-(4-methylpiperazin-1-yl)pyrimidin-4-yl]-1H-isoindole |
| SMILES | CN1CCN(c2cc(C3=NCc4ccc(OC5(C)CC5)cc43)ncn2)CC1 |
| InChI | InChI=1S/C21H25N5O/c1-21(5-6-21)27-16-4-3-15-13-22-20(17(15)11-16)18-12-19(24-14-23-18)26-9-7-25(2)8-10-26/h3-4,11-12,14H,5-10,13H2,1-2H3 |
| InChIKey | ITDFPWJKHPWRAN-UHFFFAOYSA-N |
| XLogP | 2.51 |
| TPSA | 53.85 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 363.47 |
| LogP ≤ 5 | 2.51 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 6 |