C28H31BN2O2 — CID 147981190
6-cyclohexa-1,5-dien-1-yl-2-phenyl-4-[4-(4,4,5,5-tetramethyl-1,3,2-dioxaborolan-2-yl)phenyl]-1,2-dihydropyrimidine (PubChem CID 147981190) has the molecular formula C28H31BN2O2 and a molecular weight of 438.38 g/mol. Its IUPAC name is 6-cyclohexa-1,5-dien-1-yl-2-phenyl-4-[4-(4,4,5,5-tetramethyl-1,3,2-dioxaborolan-2-yl)phenyl]-1,2-dihydropyrimidine.
| Compound Name | 6-cyclohexa-1,5-dien-1-yl-2-phenyl-4-[4-(4,4,5,5-tetramethyl-1,3,2-dioxaborolan-2-yl)phenyl]-1,2-dihydropyrimidine |
|---|---|
| PubChem CID | 147981190 |
| Molecular Formula | C28H31BN2O2 |
| Molecular Weight | 438.38 g/mol |
| Exact Mass | 438.25 |
| IUPAC Name | 6-cyclohexa-1,5-dien-1-yl-2-phenyl-4-[4-(4,4,5,5-tetramethyl-1,3,2-dioxaborolan-2-yl)phenyl]-1,2-dihydropyrimidine |
| SMILES | CC1(C)OB(c2ccc(C3=NC(c4ccccc4)NC(C4=CCCC=C4)=C3)cc2)OC1(C)C |
| InChI | InChI=1S/C28H31BN2O2/c1-27(2)28(3,4)33-29(32-27)23-17-15-21(16-18-23)25-19-24(20-11-7-5-8-12-20)30-26(31-25)22-13-9-6-10-14-22/h6-7,9-19,26,30H,5,8H2,1-4H3 |
| InChIKey | YCNMMBULIGLSRR-UHFFFAOYSA-N |
| XLogP | 5.24 |
| TPSA | 42.85 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 33 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 438.38 |
| LogP ≤ 5 | 5.24 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'} |
|---|