C17H34Cl2N6O — CID 147981203
1-(3,4-dichlorocyclohexyl)-3-[4-[3-(dimethylamino)propylamino]-6-methyl-1,3-diazinan-2-yl]urea (PubChem CID 147981203) has the molecular formula C17H34Cl2N6O and a molecular weight of 409.41 g/mol. Its IUPAC name is 1-(3,4-dichlorocyclohexyl)-3-[4-[3-(dimethylamino)propylamino]-6-methyl-1,3-diazinan-2-yl]urea.
| Compound Name | 1-(3,4-dichlorocyclohexyl)-3-[4-[3-(dimethylamino)propylamino]-6-methyl-1,3-diazinan-2-yl]urea |
|---|---|
| PubChem CID | 147981203 |
| Molecular Formula | C17H34Cl2N6O |
| Molecular Weight | 409.41 g/mol |
| Exact Mass | 408.22 |
| IUPAC Name | 1-(3,4-dichlorocyclohexyl)-3-[4-[3-(dimethylamino)propylamino]-6-methyl-1,3-diazinan-2-yl]urea |
| SMILES | CC1CC(NCCCN(C)C)NC(NC(=O)NC2CCC(Cl)C(Cl)C2)N1 |
| InChI | InChI=1S/C17H34Cl2N6O/c1-11-9-15(20-7-4-8-25(2)3)23-16(21-11)24-17(26)22-12-5-6-13(18)14(19)10-12/h11-16,20-21,23H,4-10H2,1-3H3,(H2,22,24,26) |
| InChIKey | BLBWPHSQLVBLJS-UHFFFAOYSA-N |
| XLogP | 1.18 |
| TPSA | 80.46 Ų |
| H-Bond Donors | 5 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 409.41 |
| LogP ≤ 5 | 1.18 |
| H-Bond Donors ≤ 5 | 5 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'alkyl_halide', 'substructure': 'N/A'} |
|---|