About 3a-hydroxy-6-methyl-1-phenyl-3,7-dihydro-2H-pyrrolo[2,3-b]quinolin-7-id-4-one;yttrium
3a-hydroxy-6-methyl-1-phenyl-3,7-dihydro-2H-pyrrolo[2,3-b]quinolin-7-id-4-one;yttrium (PubChem CID 147984932) has the molecular formula C18H15N2O2Y-
and a molecular weight of 380.24 g/mol. Its IUPAC name is 3a-hydroxy-6-methyl-1-phenyl-3,7-dihydro-2H-pyrrolo[2,3-b]quinolin-7-id-4-one;yttrium.
Molecular Properties
| Compound Name | 3a-hydroxy-6-methyl-1-phenyl-3,7-dihydro-2H-pyrrolo[2,3-b]quinolin-7-id-4-one;yttrium |
| PubChem CID | 147984932 |
| Molecular Formula | C18H15N2O2Y- |
| Molecular Weight | 380.24 g/mol |
| Exact Mass | 380.02 |
| IUPAC Name | 3a-hydroxy-6-methyl-1-phenyl-3,7-dihydro-2H-pyrrolo[2,3-b]quinolin-7-id-4-one;yttrium |
| SMILES | Cc1[c-]cc2c(c1)C(=O)C1(O)CCN(c3ccccc3)C1=N2.[Y] |
| InChI | InChI=1S/C18H15N2O2.Y/c1-12-7-8-15-14(11-12)16(21)18(22)9-10-20(17(18)19-15)13-5-3-2-4-6-13;/h2-6,8,11,22H,9-10H2,1H3;/q-1; |
| InChIKey | OECISZCPVUKPNQ-UHFFFAOYSA-N |
| XLogP | 2.66 |
| TPSA | 52.90 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 23 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 380.24 |
| LogP ≤ 5 | 2.66 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'Carbo_cation/anion', 'substructure': 'N/A'} |
|---|
Analyze 3a-hydroxy-6-methyl-1-phenyl-3,7-dihydro-2H-pyrrolo[2,3-b]quinolin-7-id-4-one;yttrium with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 3a-hydroxy-6-methyl-1-phenyl-3,7-dihydro-2H-pyrrolo[2,3-b]quinolin-7-id-4-one;yttrium?
The IUPAC name of 3a-hydroxy-6-methyl-1-phenyl-3,7-dihydro-2H-pyrrolo[2,3-b]quinolin-7-id-4-one;yttrium (CID 147984932) is 3a-hydroxy-6-methyl-1-phenyl-3,7-dihydro-2H-pyrrolo[2,3-b]quinolin-7-id-4-one;yttrium.
What is the SMILES notation for 3a-hydroxy-6-methyl-1-phenyl-3,7-dihydro-2H-pyrrolo[2,3-b]quinolin-7-id-4-one;yttrium?
The canonical SMILES for 3a-hydroxy-6-methyl-1-phenyl-3,7-dihydro-2H-pyrrolo[2,3-b]quinolin-7-id-4-one;yttrium is Cc1[c-]cc2c(c1)C(=O)C1(O)CCN(c3ccccc3)C1=N2.[Y].
What is the InChIKey of 3a-hydroxy-6-methyl-1-phenyl-3,7-dihydro-2H-pyrrolo[2,3-b]quinolin-7-id-4-one;yttrium?
The InChIKey is OECISZCPVUKPNQ-UHFFFAOYSA-N. The full InChI is InChI=1S/C18H15N2O2.Y/c1-12-7-8-15-14(11-12)16(21)18(22)9-10-20(17(18)19-15)13-5-3-2-4-6-13;/h2-6,8,11,22H,9-10H2,1H3;/q-1;.
What are the key properties of 3a-hydroxy-6-methyl-1-phenyl-3,7-dihydro-2H-pyrrolo[2,3-b]quinolin-7-id-4-one;yttrium?
3a-hydroxy-6-methyl-1-phenyl-3,7-dihydro-2H-pyrrolo[2,3-b]quinolin-7-id-4-one;yttrium has a molecular weight of 380.24 g/mol, XLogP of 2.66, 1 rotatable bonds, 1 hydrogen bond donors, and 4 hydrogen bond acceptors.
Where does this data come from?
All data for 3a-hydroxy-6-methyl-1-phenyl-3,7-dihydro-2H-pyrrolo[2,3-b]quinolin-7-id-4-one;yttrium is sourced from PubChem (CID 147984932), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).