C23H22FN3O3 — CID 147985315
cyclopropyl (1aS,7bR)-6-[1-[(4-fluorobenzoyl)amino]cyclopropyl]-1,1a,2,7b-tetrahydrocyclopropa[c][1,5]naphthyridine-3-carboxylate (PubChem CID 147985315) has the molecular formula C23H22FN3O3 and a molecular weight of 407.45 g/mol. Its IUPAC name is cyclopropyl (1aS,7bR)-6-[1-[(4-fluorobenzoyl)amino]cyclopropyl]-1,1a,2,7b-tetrahydrocyclopropa[c][1,5]naphthyridine-3-carboxylate.
| Compound Name | cyclopropyl (1aS,7bR)-6-[1-[(4-fluorobenzoyl)amino]cyclopropyl]-1,1a,2,7b-tetrahydrocyclopropa[c][1,5]naphthyridine-3-carboxylate |
|---|---|
| PubChem CID | 147985315 |
| Molecular Formula | C23H22FN3O3 |
| Molecular Weight | 407.45 g/mol |
| Exact Mass | 407.16 |
| IUPAC Name | cyclopropyl (1aS,7bR)-6-[1-[(4-fluorobenzoyl)amino]cyclopropyl]-1,1a,2,7b-tetrahydrocyclopropa[c][1,5]naphthyridine-3-carboxylate |
| SMILES | O=C(NC1(c2ccc3c(n2)[C@@H]2C[C@@H]2CN3C(=O)OC2CC2)CC1)c1ccc(F)cc1 |
| InChI | InChI=1S/C23H22FN3O3/c24-15-3-1-13(2-4-15)21(28)26-23(9-10-23)19-8-7-18-20(25-19)17-11-14(17)12-27(18)22(29)30-16-5-6-16/h1-4,7-8,14,16-17H,5-6,9-12H2,(H,26,28)/t14-,17-/m1/s1 |
| InChIKey | IUAGHGOLYBDMFU-RHSMWYFYSA-N |
| XLogP | 3.86 |
| TPSA | 71.53 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 30 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 407.45 |
| LogP ≤ 5 | 3.86 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |