About 9-cyclopropyl-7-[5-(trifluoromethyl)-1H-pyrazol-4-yl]-3H-pyrazolo[4,5-f]quinoline
9-cyclopropyl-7-[5-(trifluoromethyl)-1H-pyrazol-4-yl]-3H-pyrazolo[4,5-f]quinoline (PubChem CID 147987870) has the molecular formula C17H12F3N5
and a molecular weight of 343.31 g/mol. Its IUPAC name is 9-cyclopropyl-7-[5-(trifluoromethyl)-1H-pyrazol-4-yl]-3H-pyrazolo[4,5-f]quinoline.
Molecular Properties
| Compound Name | 9-cyclopropyl-7-[5-(trifluoromethyl)-1H-pyrazol-4-yl]-3H-pyrazolo[4,5-f]quinoline |
| PubChem CID | 147987870 |
| Molecular Formula | C17H12F3N5 |
| Molecular Weight | 343.31 g/mol |
| Exact Mass | 343.10 |
| IUPAC Name | 9-cyclopropyl-7-[5-(trifluoromethyl)-1H-pyrazol-4-yl]-3H-pyrazolo[4,5-f]quinoline |
| SMILES | FC(F)(F)c1[nH]ncc1-c1cc(C2CC2)c2c(ccc3[nH]ncc32)n1 |
| InChI | InChI=1S/C17H12F3N5/c18-17(19,20)16-11(7-22-25-16)14-5-9(8-1-2-8)15-10-6-21-24-12(10)3-4-13(15)23-14/h3-8H,1-2H2,(H,21,24)(H,22,25) |
| InChIKey | IUMARYQWTKVJMI-UHFFFAOYSA-N |
| XLogP | 4.40 |
| TPSA | 70.25 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 25 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 343.31 |
| LogP ≤ 5 | 4.40 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |
Analyze 9-cyclopropyl-7-[5-(trifluoromethyl)-1H-pyrazol-4-yl]-3H-pyrazolo[4,5-f]quinoline with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 9-cyclopropyl-7-[5-(trifluoromethyl)-1H-pyrazol-4-yl]-3H-pyrazolo[4,5-f]quinoline?
The IUPAC name of 9-cyclopropyl-7-[5-(trifluoromethyl)-1H-pyrazol-4-yl]-3H-pyrazolo[4,5-f]quinoline (CID 147987870) is 9-cyclopropyl-7-[5-(trifluoromethyl)-1H-pyrazol-4-yl]-3H-pyrazolo[4,5-f]quinoline.
What is the SMILES notation for 9-cyclopropyl-7-[5-(trifluoromethyl)-1H-pyrazol-4-yl]-3H-pyrazolo[4,5-f]quinoline?
The canonical SMILES for 9-cyclopropyl-7-[5-(trifluoromethyl)-1H-pyrazol-4-yl]-3H-pyrazolo[4,5-f]quinoline is FC(F)(F)c1[nH]ncc1-c1cc(C2CC2)c2c(ccc3[nH]ncc32)n1.
What is the InChIKey of 9-cyclopropyl-7-[5-(trifluoromethyl)-1H-pyrazol-4-yl]-3H-pyrazolo[4,5-f]quinoline?
The InChIKey is IUMARYQWTKVJMI-UHFFFAOYSA-N. The full InChI is InChI=1S/C17H12F3N5/c18-17(19,20)16-11(7-22-25-16)14-5-9(8-1-2-8)15-10-6-21-24-12(10)3-4-13(15)23-14/h3-8H,1-2H2,(H,21,24)(H,22,25).
What are the key properties of 9-cyclopropyl-7-[5-(trifluoromethyl)-1H-pyrazol-4-yl]-3H-pyrazolo[4,5-f]quinoline?
9-cyclopropyl-7-[5-(trifluoromethyl)-1H-pyrazol-4-yl]-3H-pyrazolo[4,5-f]quinoline has a molecular weight of 343.31 g/mol, XLogP of 4.40, 2 rotatable bonds, 2 hydrogen bond donors, and 3 hydrogen bond acceptors.
Where does this data come from?
All data for 9-cyclopropyl-7-[5-(trifluoromethyl)-1H-pyrazol-4-yl]-3H-pyrazolo[4,5-f]quinoline is sourced from PubChem (CID 147987870), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).