About 2-[(E)-3,3-dimethylbut-1-enyl]-5-methoxythiophene
2-[(E)-3,3-dimethylbut-1-enyl]-5-methoxythiophene (PubChem CID 147989570) has the molecular formula C11H16OS
and a molecular weight of 196.31 g/mol. Its IUPAC name is 2-[(E)-3,3-dimethylbut-1-enyl]-5-methoxythiophene.
Molecular Properties
| Compound Name | 2-[(E)-3,3-dimethylbut-1-enyl]-5-methoxythiophene |
| PubChem CID | 147989570 |
| Molecular Formula | C11H16OS |
| Molecular Weight | 196.31 g/mol |
| Exact Mass | 196.09 |
| IUPAC Name | 2-[(E)-3,3-dimethylbut-1-enyl]-5-methoxythiophene |
| SMILES | COc1ccc(/C=C/C(C)(C)C)s1 |
| InChI | InChI=1S/C11H16OS/c1-11(2,3)8-7-9-5-6-10(12-4)13-9/h5-8H,1-4H3/b8-7+ |
| InChIKey | IUUIXQREVZEXSM-BQYQJAHWSA-N |
| XLogP | 3.82 |
| TPSA | 9.23 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 13 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 196.31 |
| LogP ≤ 5 | 3.82 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
Analyze 2-[(E)-3,3-dimethylbut-1-enyl]-5-methoxythiophene with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 2-[(E)-3,3-dimethylbut-1-enyl]-5-methoxythiophene?
The IUPAC name of 2-[(E)-3,3-dimethylbut-1-enyl]-5-methoxythiophene (CID 147989570) is 2-[(E)-3,3-dimethylbut-1-enyl]-5-methoxythiophene.
What is the SMILES notation for 2-[(E)-3,3-dimethylbut-1-enyl]-5-methoxythiophene?
The canonical SMILES for 2-[(E)-3,3-dimethylbut-1-enyl]-5-methoxythiophene is COc1ccc(/C=C/C(C)(C)C)s1.
What is the InChIKey of 2-[(E)-3,3-dimethylbut-1-enyl]-5-methoxythiophene?
The InChIKey is IUUIXQREVZEXSM-BQYQJAHWSA-N. The full InChI is InChI=1S/C11H16OS/c1-11(2,3)8-7-9-5-6-10(12-4)13-9/h5-8H,1-4H3/b8-7+.
What are the key properties of 2-[(E)-3,3-dimethylbut-1-enyl]-5-methoxythiophene?
2-[(E)-3,3-dimethylbut-1-enyl]-5-methoxythiophene has a molecular weight of 196.31 g/mol, XLogP of 3.82, 2 rotatable bonds, 0 hydrogen bond donors, and 2 hydrogen bond acceptors.
Where does this data come from?
All data for 2-[(E)-3,3-dimethylbut-1-enyl]-5-methoxythiophene is sourced from PubChem (CID 147989570), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).