C39H43N3 — CID 147991489
5-[3-[5-(12,12-dimethyl-4a,6,7,7b,8,9,11a,12c-octahydroindeno[1,2-c]carbazol-5-yl)cyclohexa-1,5-dien-1-yl]cyclohex-2-en-1-yl]-2,3-dihydropyridine-3-carbonitrile (PubChem CID 147991489) has the molecular formula C39H43N3 and a molecular weight of 553.79 g/mol. Its IUPAC name is 5-[3-[5-(12,12-dimethyl-4a,6,7,7b,8,9,11a,12c-octahydroindeno[1,2-c]carbazol-5-yl)cyclohexa-1,5-dien-1-yl]cyclohex-2-en-1-yl]-2,3-dihydropyridine-3-carbonitrile.
| Compound Name | 5-[3-[5-(12,12-dimethyl-4a,6,7,7b,8,9,11a,12c-octahydroindeno[1,2-c]carbazol-5-yl)cyclohexa-1,5-dien-1-yl]cyclohex-2-en-1-yl]-2,3-dihydropyridine-3-carbonitrile |
|---|---|
| PubChem CID | 147991489 |
| Molecular Formula | C39H43N3 |
| Molecular Weight | 553.79 g/mol |
| Exact Mass | 553.35 |
| IUPAC Name | 5-[3-[5-(12,12-dimethyl-4a,6,7,7b,8,9,11a,12c-octahydroindeno[1,2-c]carbazol-5-yl)cyclohexa-1,5-dien-1-yl]cyclohex-2-en-1-yl]-2,3-dihydropyridine-3-carbonitrile |
| SMILES | CC1(C)C2=C(CCC3=C2C2C=CC=CC2N3C2=CC(C3=CC(C4=CC(C#N)CN=C4)CCC3)=CCC2)C2CCC=CC21 |
| InChI | InChI=1S/C39H43N3/c1-39(2)34-15-5-3-13-31(34)32-17-18-36-37(38(32)39)33-14-4-6-16-35(33)42(36)30-12-8-11-28(21-30)26-9-7-10-27(20-26)29-19-25(22-40)23-41-24-29/h4-6,11,14-16,19-21,24-25,27,31,33-35H,3,7-10,12-13,17-18,23H2,1-2H3 |
| InChIKey | IVDUMYUVKDMSIN-UHFFFAOYSA-N |
| XLogP | 8.86 |
| TPSA | 39.39 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 42 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 553.79 |
| LogP ≤ 5 | 8.86 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|