C26H25F3N4O4S — CID 147991728
[3-[2-[[4-(2-pyrrolidin-1-ylethoxy)phenyl]methyl]-[1,2,4]triazolo[1,5-a]pyridin-5-yl]phenyl] trifluoromethanesulfonate (PubChem CID 147991728) has the molecular formula C26H25F3N4O4S and a molecular weight of 546.57 g/mol. Its IUPAC name is [3-[2-[[4-(2-pyrrolidin-1-ylethoxy)phenyl]methyl]-[1,2,4]triazolo[1,5-a]pyridin-5-yl]phenyl] trifluoromethanesulfonate.
| Compound Name | [3-[2-[[4-(2-pyrrolidin-1-ylethoxy)phenyl]methyl]-[1,2,4]triazolo[1,5-a]pyridin-5-yl]phenyl] trifluoromethanesulfonate |
|---|---|
| PubChem CID | 147991728 |
| Molecular Formula | C26H25F3N4O4S |
| Molecular Weight | 546.57 g/mol |
| Exact Mass | 546.15 |
| IUPAC Name | [3-[2-[[4-(2-pyrrolidin-1-ylethoxy)phenyl]methyl]-[1,2,4]triazolo[1,5-a]pyridin-5-yl]phenyl] trifluoromethanesulfonate |
| SMILES | O=S(=O)(Oc1cccc(-c2cccc3nc(Cc4ccc(OCCN5CCCC5)cc4)nn23)c1)C(F)(F)F |
| InChI | InChI=1S/C26H25F3N4O4S/c27-26(28,29)38(34,35)37-22-6-3-5-20(18-22)23-7-4-8-25-30-24(31-33(23)25)17-19-9-11-21(12-10-19)36-16-15-32-13-1-2-14-32/h3-12,18H,1-2,13-17H2 |
| InChIKey | IVEZQQDOEUHHPS-UHFFFAOYSA-N |
| XLogP | 4.69 |
| TPSA | 86.03 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 38 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 546.57 |
| LogP ≤ 5 | 4.69 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'Sulfonic_acid_1', 'substructure': 'N/A'}, {'alert_name': 'triflate', 'substructure': 'N/A'} |
|---|