C18H33N2O4+ — CID 147992103
(2S)-2-[[(2S)-2-[2-(1,1-dimethylpiperidin-1-ium-4-yl)-2-oxoethyl]-3,3-dimethylbutanoyl]amino]propanoic acid (PubChem CID 147992103) has the molecular formula C18H33N2O4+ and a molecular weight of 341.47 g/mol. Its IUPAC name is (2S)-2-[[(2S)-2-[2-(1,1-dimethylpiperidin-1-ium-4-yl)-2-oxoethyl]-3,3-dimethylbutanoyl]amino]propanoic acid.
| Compound Name | (2S)-2-[[(2S)-2-[2-(1,1-dimethylpiperidin-1-ium-4-yl)-2-oxoethyl]-3,3-dimethylbutanoyl]amino]propanoic acid |
|---|---|
| PubChem CID | 147992103 |
| Molecular Formula | C18H33N2O4+ |
| Molecular Weight | 341.47 g/mol |
| Exact Mass | 341.24 |
| IUPAC Name | (2S)-2-[[(2S)-2-[2-(1,1-dimethylpiperidin-1-ium-4-yl)-2-oxoethyl]-3,3-dimethylbutanoyl]amino]propanoic acid |
| SMILES | C[C@H](NC(=O)[C@@H](CC(=O)C1CC[N+](C)(C)CC1)C(C)(C)C)C(=O)O |
| InChI | InChI=1S/C18H32N2O4/c1-12(17(23)24)19-16(22)14(18(2,3)4)11-15(21)13-7-9-20(5,6)10-8-13/h12-14H,7-11H2,1-6H3,(H-,19,22,23,24)/p+1/t12-,14+/m0/s1 |
| InChIKey | IVGUMOYWABJYTJ-GXTWGEPZSA-O |
| XLogP | 1.68 |
| TPSA | 83.47 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 341.47 |
| LogP ≤ 5 | 1.68 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'quaternary_nitrogen_2', 'substructure': 'N/A'} |
|---|