C14H18N2O4 — CID 147994325
6-(oxetan-3-ylmethoxy)-5-pyrrolidin-1-ylpyridine-2-carboxylic acid (PubChem CID 147994325) has the molecular formula C14H18N2O4 and a molecular weight of 278.31 g/mol. Its IUPAC name is 6-(oxetan-3-ylmethoxy)-5-pyrrolidin-1-ylpyridine-2-carboxylic acid.
| Compound Name | 6-(oxetan-3-ylmethoxy)-5-pyrrolidin-1-ylpyridine-2-carboxylic acid |
|---|---|
| PubChem CID | 147994325 |
| Molecular Formula | C14H18N2O4 |
| Molecular Weight | 278.31 g/mol |
| Exact Mass | 278.13 |
| IUPAC Name | 6-(oxetan-3-ylmethoxy)-5-pyrrolidin-1-ylpyridine-2-carboxylic acid |
| SMILES | O=C(O)c1ccc(N2CCCC2)c(OCC2COC2)n1 |
| InChI | InChI=1S/C14H18N2O4/c17-14(18)11-3-4-12(16-5-1-2-6-16)13(15-11)20-9-10-7-19-8-10/h3-4,10H,1-2,5-9H2,(H,17,18) |
| InChIKey | IVRVCJIPJUNWIE-UHFFFAOYSA-N |
| XLogP | 1.41 |
| TPSA | 71.89 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 278.31 |
| LogP ≤ 5 | 1.41 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |