C15H22O — CID 14801281
7a-methyl-1-pent-4-yn-2-yl-3,3a,4,5,6,7-hexahydroinden-4-ol (PubChem CID 14801281) has the molecular formula C15H22O and a molecular weight of 218.34 g/mol. Its IUPAC name is 7a-methyl-1-pent-4-yn-2-yl-3,3a,4,5,6,7-hexahydroinden-4-ol.
| Compound Name | 7a-methyl-1-pent-4-yn-2-yl-3,3a,4,5,6,7-hexahydroinden-4-ol |
|---|---|
| PubChem CID | 14801281 |
| Molecular Formula | C15H22O |
| Molecular Weight | 218.34 g/mol |
| Exact Mass | 218.17 |
| IUPAC Name | 7a-methyl-1-pent-4-yn-2-yl-3,3a,4,5,6,7-hexahydroinden-4-ol |
| SMILES | C#CCC(C)C1=CCC2C(O)CCCC12C |
| InChI | InChI=1S/C15H22O/c1-4-6-11(2)12-8-9-13-14(16)7-5-10-15(12,13)3/h1,8,11,13-14,16H,5-7,9-10H2,2-3H3 |
| InChIKey | FCIPCOOPFWPSTQ-UHFFFAOYSA-N |
| XLogP | 3.14 |
| TPSA | 20.23 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 16 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 218.34 |
| LogP ≤ 5 | 3.14 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 1 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'}, {'alert_name': 'triple_bond', 'substructure': 'N/A'} |
|---|