C21H30F2O3 — CID 14801346
(8S,9S,10S,13S,14S,17S)-10-(difluoromethyl)-13-methylspiro[1,2,4,7,8,9,11,12,14,15,16,17-dodecahydrocyclopenta[a]phenanthrene-3,2'-1,3-dioxolane]-17-ol (PubChem CID 14801346) has the molecular formula C21H30F2O3 and a molecular weight of 368.46 g/mol. Its IUPAC name is (8S,9S,10S,13S,14S,17S)-10-(difluoromethyl)-13-methylspiro[1,2,4,7,8,9,11,12,14,15,16,17-dodecahydrocyclopenta[a]phenanthrene-3,2'-1,3-dioxolane]-17-ol.
| Compound Name | (8S,9S,10S,13S,14S,17S)-10-(difluoromethyl)-13-methylspiro[1,2,4,7,8,9,11,12,14,15,16,17-dodecahydrocyclopenta[a]phenanthrene-3,2'-1,3-dioxolane]-17-ol |
|---|---|
| PubChem CID | 14801346 |
| Molecular Formula | C21H30F2O3 |
| Molecular Weight | 368.46 g/mol |
| Exact Mass | 368.22 |
| IUPAC Name | (8S,9S,10S,13S,14S,17S)-10-(difluoromethyl)-13-methylspiro[1,2,4,7,8,9,11,12,14,15,16,17-dodecahydrocyclopenta[a]phenanthrene-3,2'-1,3-dioxolane]-17-ol |
| SMILES | C[C@]12CC[C@H]3[C@@H](CC=C4CC5(CC[C@@]43C(F)F)OCCO5)[C@@H]1CC[C@@H]2O |
| InChI | InChI=1S/C21H30F2O3/c1-19-7-6-16-14(15(19)4-5-17(19)24)3-2-13-12-20(25-10-11-26-20)8-9-21(13,16)18(22)23/h2,14-18,24H,3-12H2,1H3/t14-,15-,16-,17-,19-,21+/m0/s1 |
| InChIKey | XEQKMNXCVCFOJJ-TWTKXFDXSA-N |
| XLogP | 4.30 |
| TPSA | 38.69 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 368.46 |
| LogP ≤ 5 | 4.30 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|