C21H28F2O3 — CID 14801348
(8'S,9'S,10'S,13'S,14'S)-10'-(difluoromethyl)-13'-methylspiro[1,3-dioxolane-2,3'-2,4,7,8,9,11,12,14,15,16-decahydro-1H-cyclopenta[a]phenanthrene]-17'-one (PubChem CID 14801348) has the molecular formula C21H28F2O3 and a molecular weight of 366.45 g/mol. Its IUPAC name is (8'S,9'S,10'S,13'S,14'S)-10'-(difluoromethyl)-13'-methylspiro[1,3-dioxolane-2,3'-2,4,7,8,9,11,12,14,15,16-decahydro-1H-cyclopenta[a]phenanthrene]-17'-one.
| Compound Name | (8'S,9'S,10'S,13'S,14'S)-10'-(difluoromethyl)-13'-methylspiro[1,3-dioxolane-2,3'-2,4,7,8,9,11,12,14,15,16-decahydro-1H-cyclopenta[a]phenanthrene]-17'-one |
|---|---|
| PubChem CID | 14801348 |
| Molecular Formula | C21H28F2O3 |
| Molecular Weight | 366.45 g/mol |
| Exact Mass | 366.20 |
| IUPAC Name | (8'S,9'S,10'S,13'S,14'S)-10'-(difluoromethyl)-13'-methylspiro[1,3-dioxolane-2,3'-2,4,7,8,9,11,12,14,15,16-decahydro-1H-cyclopenta[a]phenanthrene]-17'-one |
| SMILES | C[C@]12CC[C@H]3[C@@H](CC=C4CC5(CC[C@@]43C(F)F)OCCO5)[C@@H]1CCC2=O |
| InChI | InChI=1S/C21H28F2O3/c1-19-7-6-16-14(15(19)4-5-17(19)24)3-2-13-12-20(25-10-11-26-20)8-9-21(13,16)18(22)23/h2,14-16,18H,3-12H2,1H3/t14-,15-,16-,19-,21+/m0/s1 |
| InChIKey | KNPXQDFGKXBXIU-RMWAXNGCSA-N |
| XLogP | 4.51 |
| TPSA | 35.53 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 366.45 |
| LogP ≤ 5 | 4.51 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|