About 4-(methylamino)-1H-1,2,4-triazol-5-one
4-(methylamino)-1H-1,2,4-triazol-5-one (PubChem CID 14801432) has the molecular formula C3H6N4O
and a molecular weight of 114.11 g/mol. Its IUPAC name is 4-(methylamino)-1H-1,2,4-triazol-5-one.
Molecular Properties
| Compound Name | 4-(methylamino)-1H-1,2,4-triazol-5-one |
| PubChem CID | 14801432 |
| Molecular Formula | C3H6N4O |
| Molecular Weight | 114.11 g/mol |
| Exact Mass | 114.05 |
| IUPAC Name | 4-(methylamino)-1H-1,2,4-triazol-5-one |
| SMILES | CNn1cn[nH]c1=O |
| InChI | InChI=1S/C3H6N4O/c1-4-7-2-5-6-3(7)8/h2,4H,1H3,(H,6,8) |
| InChIKey | QXCAPLALSWNAKH-UHFFFAOYSA-N |
| XLogP | -1.26 |
| TPSA | 62.71 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 8 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 114.11 |
| LogP ≤ 5 | -1.26 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
Analyze 4-(methylamino)-1H-1,2,4-triazol-5-one with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 4-(methylamino)-1H-1,2,4-triazol-5-one?
The IUPAC name of 4-(methylamino)-1H-1,2,4-triazol-5-one (CID 14801432) is 4-(methylamino)-1H-1,2,4-triazol-5-one.
What is the SMILES notation for 4-(methylamino)-1H-1,2,4-triazol-5-one?
The canonical SMILES for 4-(methylamino)-1H-1,2,4-triazol-5-one is CNn1cn[nH]c1=O.
What is the InChIKey of 4-(methylamino)-1H-1,2,4-triazol-5-one?
The InChIKey is QXCAPLALSWNAKH-UHFFFAOYSA-N. The full InChI is InChI=1S/C3H6N4O/c1-4-7-2-5-6-3(7)8/h2,4H,1H3,(H,6,8).
What are the key properties of 4-(methylamino)-1H-1,2,4-triazol-5-one?
4-(methylamino)-1H-1,2,4-triazol-5-one has a molecular weight of 114.11 g/mol, XLogP of -1.26, 1 rotatable bonds, 2 hydrogen bond donors, and 4 hydrogen bond acceptors.
Where does this data come from?
All data for 4-(methylamino)-1H-1,2,4-triazol-5-one is sourced from PubChem (CID 14801432), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).