2-[2-[2-(carboxymethyl)phenoxy]phenyl]acetic acid

C16H14O5 — CID 14801619

IUPAC2-[2-[2-(carboxymethyl)phenoxy]phenyl]acetic acid
SMILESO=C(O)Cc1ccccc1Oc1ccccc1CC(=O)O
InChIInChI=1S/C16H14O5/c17-15(18)9-11-5-1-3-7-13(11)21-14-8-4-2-6-12(14)10-16(19)20/h1-8H,9-10H2,(H,17,18)(H,19,20)
InChIKeyDQRZVYFNUJPUPX-UHFFFAOYSA-N
MW286.28 g/mol
LogP2.73
Rot. Bonds6

About 2-[2-[2-(carboxymethyl)phenoxy]phenyl]acetic acid

2-[2-[2-(carboxymethyl)phenoxy]phenyl]acetic acid (PubChem CID 14801619) has the molecular formula C16H14O5 and a molecular weight of 286.28 g/mol. Its IUPAC name is 2-[2-[2-(carboxymethyl)phenoxy]phenyl]acetic acid.

Molecular Properties

Compound Name2-[2-[2-(carboxymethyl)phenoxy]phenyl]acetic acid
PubChem CID14801619
Molecular FormulaC16H14O5
Molecular Weight286.28 g/mol
Exact Mass286.08
IUPAC Name2-[2-[2-(carboxymethyl)phenoxy]phenyl]acetic acid
SMILESO=C(O)Cc1ccccc1Oc1ccccc1CC(=O)O
InChIInChI=1S/C16H14O5/c17-15(18)9-11-5-1-3-7-13(11)21-14-8-4-2-6-12(14)10-16(19)20/h1-8H,9-10H2,(H,17,18)(H,19,20)
InChIKeyDQRZVYFNUJPUPX-UHFFFAOYSA-N
XLogP2.73
TPSA83.83 Ų
H-Bond Donors2
H-Bond Acceptors3
Rotatable Bonds6
Heavy Atoms21
Complexity—

Lipinski Rule of Five

Passes Rule of Five

RuleValue
MW ≤ 500286.28
LogP ≤ 52.73
H-Bond Donors ≤ 52
H-Bond Acceptors ≤ 103

Analyze 2-[2-[2-(carboxymethyl)phenoxy]phenyl]acetic acid with MolForge

Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.

Launch Full Analysis

Related Compounds

2-[2-(2-aminophenoxy)phenyl]acetic acid
CID 13409453
2-(2-pyrimidin-2-yloxyphenyl)acetic acid
CID 70166639
2-[2-(2,3-dipropylphenoxy)phenyl]acetic acid
CID 21113142
2-[2-(2,4-dibromophenoxy)phenyl]acetic acid
CID 15581881
2-[2-[(3-methyl-4-pyridinyl)oxy]phenyl]acetic acid
CID 80742147
2-(2-quinoxalin-2-yloxyphenyl)acetic acid
CID 80735910
CID 172781038
CID 172781038
CID 172781001
CID 172781001
2-[2-(2-chloro-4-ethylphenoxy)phenyl]acetic acid
CID 15581880
2-[2-(6-carbamoylpyridazin-3-yl)oxyphenyl]acetic acid
CID 80742351
2-[2-[(3-methyl-2-pyridinyl)oxy]phenyl]acetic acid
CID 80741818
2-[2-(3-hydroxypropoxy)phenyl]acetic acid
CID 80742548

Frequently Asked Questions

What is the IUPAC name of 2-[2-[2-(carboxymethyl)phenoxy]phenyl]acetic acid?
The IUPAC name of 2-[2-[2-(carboxymethyl)phenoxy]phenyl]acetic acid (CID 14801619) is 2-[2-[2-(carboxymethyl)phenoxy]phenyl]acetic acid.
What is the SMILES notation for 2-[2-[2-(carboxymethyl)phenoxy]phenyl]acetic acid?
The canonical SMILES for 2-[2-[2-(carboxymethyl)phenoxy]phenyl]acetic acid is O=C(O)Cc1ccccc1Oc1ccccc1CC(=O)O.
What is the InChIKey of 2-[2-[2-(carboxymethyl)phenoxy]phenyl]acetic acid?
The InChIKey is DQRZVYFNUJPUPX-UHFFFAOYSA-N. The full InChI is InChI=1S/C16H14O5/c17-15(18)9-11-5-1-3-7-13(11)21-14-8-4-2-6-12(14)10-16(19)20/h1-8H,9-10H2,(H,17,18)(H,19,20).
What are the key properties of 2-[2-[2-(carboxymethyl)phenoxy]phenyl]acetic acid?
2-[2-[2-(carboxymethyl)phenoxy]phenyl]acetic acid has a molecular weight of 286.28 g/mol, XLogP of 2.73, 6 rotatable bonds, 2 hydrogen bond donors, and 3 hydrogen bond acceptors.
Where does this data come from?
All data for 2-[2-[2-(carboxymethyl)phenoxy]phenyl]acetic acid is sourced from PubChem (CID 14801619), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).