C16H21Cl3O10 — CID 14802449
[3,4,5-triacetyloxy-6-(2,2,2-trichloroethoxy)oxan-2-yl]methyl acetate (PubChem CID 14802449) has the molecular formula C16H21Cl3O10 and a molecular weight of 479.69 g/mol. Its IUPAC name is [3,4,5-triacetyloxy-6-(2,2,2-trichloroethoxy)oxan-2-yl]methyl acetate.
| Compound Name | [3,4,5-triacetyloxy-6-(2,2,2-trichloroethoxy)oxan-2-yl]methyl acetate |
|---|---|
| PubChem CID | 14802449 |
| Molecular Formula | C16H21Cl3O10 |
| Molecular Weight | 479.69 g/mol |
| Exact Mass | 478.02 |
| IUPAC Name | [3,4,5-triacetyloxy-6-(2,2,2-trichloroethoxy)oxan-2-yl]methyl acetate |
| SMILES | CC(=O)OCC1OC(OCC(Cl)(Cl)Cl)C(OC(C)=O)C(OC(C)=O)C1OC(C)=O |
| InChI | InChI=1S/C16H21Cl3O10/c1-7(20)24-5-11-12(26-8(2)21)13(27-9(3)22)14(28-10(4)23)15(29-11)25-6-16(17,18)19/h11-15H,5-6H2,1-4H3 |
| InChIKey | ZPOUBPQPUBJOON-UHFFFAOYSA-N |
| XLogP | 1.46 |
| TPSA | 123.66 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 10 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 29 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 479.69 |
| LogP ≤ 5 | 1.46 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 10 |
| Structural Alerts | {'alert_name': '>_2_ester_groups', 'substructure': 'N/A'}, {'alert_name': 'alkyl_halide', 'substructure': 'N/A'} |
|---|