C25H48O — CID 14804078
(E)-2,10,16-trimethyldocos-2-enal (PubChem CID 14804078) has the molecular formula C25H48O and a molecular weight of 364.66 g/mol. Its IUPAC name is (E)-2,10,16-trimethyldocos-2-enal.
| Compound Name | (E)-2,10,16-trimethyldocos-2-enal |
|---|---|
| PubChem CID | 14804078 |
| Molecular Formula | C25H48O |
| Molecular Weight | 364.66 g/mol |
| Exact Mass | 364.37 |
| IUPAC Name | (E)-2,10,16-trimethyldocos-2-enal |
| SMILES | CCCCCCC(C)CCCCCC(C)CCCCCC/C=C(\C)C=O |
| InChI | InChI=1S/C25H48O/c1-5-6-7-12-17-23(2)19-15-11-16-20-24(3)18-13-9-8-10-14-21-25(4)22-26/h21-24H,5-20H2,1-4H3/b25-21+ |
| InChIKey | PKNPCJNZCKFJLV-NJNXFGOHSA-N |
| XLogP | 8.67 |
| TPSA | 17.07 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 19 |
| Heavy Atoms | 26 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 364.66 |
| LogP ≤ 5 | 8.67 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 1 |
| Structural Alerts | {'alert_name': 'aldehyde', 'substructure': 'N/A'}, {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|