C9H12F3NO4 — CID 14804183
1-[(2R,3R,3aR,6aR)-3-hydroxy-2-methoxy-2,3,3a,5,6,6a-hexahydrofuro[3,2-b]pyrrol-4-yl]-2,2,2-trifluoroethanone (PubChem CID 14804183) has the molecular formula C9H12F3NO4 and a molecular weight of 255.19 g/mol. Its IUPAC name is 1-[(2R,3R,3aR,6aR)-3-hydroxy-2-methoxy-2,3,3a,5,6,6a-hexahydrofuro[3,2-b]pyrrol-4-yl]-2,2,2-trifluoroethanone.
| Compound Name | 1-[(2R,3R,3aR,6aR)-3-hydroxy-2-methoxy-2,3,3a,5,6,6a-hexahydrofuro[3,2-b]pyrrol-4-yl]-2,2,2-trifluoroethanone |
|---|---|
| PubChem CID | 14804183 |
| Molecular Formula | C9H12F3NO4 |
| Molecular Weight | 255.19 g/mol |
| Exact Mass | 255.07 |
| IUPAC Name | 1-[(2R,3R,3aR,6aR)-3-hydroxy-2-methoxy-2,3,3a,5,6,6a-hexahydrofuro[3,2-b]pyrrol-4-yl]-2,2,2-trifluoroethanone |
| SMILES | CO[C@@H]1O[C@@H]2CCN(C(=O)C(F)(F)F)[C@@H]2[C@H]1O |
| InChI | InChI=1S/C9H12F3NO4/c1-16-7-6(14)5-4(17-7)2-3-13(5)8(15)9(10,11)12/h4-7,14H,2-3H2,1H3/t4-,5+,6-,7-/m1/s1 |
| InChIKey | IJTMIODUAAJEMS-XZBKPIIZSA-N |
| XLogP | -0.12 |
| TPSA | 59.00 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 17 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 255.19 |
| LogP ≤ 5 | -0.12 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |