About 2-methoxy-3,4-dihydro-2H-chromene
2-methoxy-3,4-dihydro-2H-chromene (PubChem CID 14804728) has the molecular formula C10H12O2
and a molecular weight of 164.20 g/mol. Its IUPAC name is 2-methoxy-3,4-dihydro-2H-chromene.
Molecular Properties
| Compound Name | 2-methoxy-3,4-dihydro-2H-chromene |
| PubChem CID | 14804728 |
| Molecular Formula | C10H12O2 |
| Molecular Weight | 164.20 g/mol |
| Exact Mass | 164.08 |
| IUPAC Name | 2-methoxy-3,4-dihydro-2H-chromene |
| SMILES | COC1CCc2ccccc2O1 |
| InChI | InChI=1S/C10H12O2/c1-11-10-7-6-8-4-2-3-5-9(8)12-10/h2-5,10H,6-7H2,1H3 |
| InChIKey | MHPHKESQAFULBY-UHFFFAOYSA-N |
| XLogP | 1.98 |
| TPSA | 18.46 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 12 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 164.20 |
| LogP ≤ 5 | 1.98 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
Analyze 2-methoxy-3,4-dihydro-2H-chromene with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 2-methoxy-3,4-dihydro-2H-chromene?
The IUPAC name of 2-methoxy-3,4-dihydro-2H-chromene (CID 14804728) is 2-methoxy-3,4-dihydro-2H-chromene.
What is the SMILES notation for 2-methoxy-3,4-dihydro-2H-chromene?
The canonical SMILES for 2-methoxy-3,4-dihydro-2H-chromene is COC1CCc2ccccc2O1.
What is the InChIKey of 2-methoxy-3,4-dihydro-2H-chromene?
The InChIKey is MHPHKESQAFULBY-UHFFFAOYSA-N. The full InChI is InChI=1S/C10H12O2/c1-11-10-7-6-8-4-2-3-5-9(8)12-10/h2-5,10H,6-7H2,1H3.
What are the key properties of 2-methoxy-3,4-dihydro-2H-chromene?
2-methoxy-3,4-dihydro-2H-chromene has a molecular weight of 164.20 g/mol, XLogP of 1.98, 1 rotatable bonds, 0 hydrogen bond donors, and 2 hydrogen bond acceptors.
Where does this data come from?
All data for 2-methoxy-3,4-dihydro-2H-chromene is sourced from PubChem (CID 14804728), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).