C22H37Cl2NO5Si2 — CID 14805176
(6aR,8S,9S,9aS)-8-(2,6-dichloro-3-pyridinyl)-2,2,4,4-tetra(propan-2-yl)-6a,8,9,9a-tetrahydro-6H-furo[3,2-f][1,3,5,2,4]trioxadisilocin-9-ol (PubChem CID 14805176) has the molecular formula C22H37Cl2NO5Si2 and a molecular weight of 522.62 g/mol. Its IUPAC name is (6aR,8S,9S,9aS)-8-(2,6-dichloro-3-pyridinyl)-2,2,4,4-tetra(propan-2-yl)-6a,8,9,9a-tetrahydro-6H-furo[3,2-f][1,3,5,2,4]trioxadisilocin-9-ol.
| Compound Name | (6aR,8S,9S,9aS)-8-(2,6-dichloro-3-pyridinyl)-2,2,4,4-tetra(propan-2-yl)-6a,8,9,9a-tetrahydro-6H-furo[3,2-f][1,3,5,2,4]trioxadisilocin-9-ol |
|---|---|
| PubChem CID | 14805176 |
| Molecular Formula | C22H37Cl2NO5Si2 |
| Molecular Weight | 522.62 g/mol |
| Exact Mass | 521.16 |
| IUPAC Name | (6aR,8S,9S,9aS)-8-(2,6-dichloro-3-pyridinyl)-2,2,4,4-tetra(propan-2-yl)-6a,8,9,9a-tetrahydro-6H-furo[3,2-f][1,3,5,2,4]trioxadisilocin-9-ol |
| SMILES | CC(C)[Si]1(C(C)C)OC[C@H]2O[C@@H](c3ccc(Cl)nc3Cl)[C@H](O)[C@@H]2O[Si](C(C)C)(C(C)C)O1 |
| InChI | InChI=1S/C22H37Cl2NO5Si2/c1-12(2)31(13(3)4)27-11-17-21(29-32(30-31,14(5)6)15(7)8)19(26)20(28-17)16-9-10-18(23)25-22(16)24/h9-10,12-15,17,19-21,26H,11H2,1-8H3/t17-,19+,20+,21-/m1/s1 |
| InChIKey | DOIDLIUYLDJXPN-BVOGOJNSSA-N |
| XLogP | 6.15 |
| TPSA | 70.04 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 32 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 522.62 |
| LogP ≤ 5 | 6.15 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': '2-halo_pyridine', 'substructure': 'N/A'}, {'alert_name': 'heavy_metal', 'substructure': 'N/A'} |
|---|