About (7E)-2,7-dimethyl-10-(oxan-2-yloxy)deca-1,7-dien-3-yn-5-ol
(7E)-2,7-dimethyl-10-(oxan-2-yloxy)deca-1,7-dien-3-yn-5-ol (PubChem CID 14805456) has the molecular formula C17H26O3
and a molecular weight of 278.39 g/mol. Its IUPAC name is (7E)-2,7-dimethyl-10-(oxan-2-yloxy)deca-1,7-dien-3-yn-5-ol.
Molecular Properties
| Compound Name | (7E)-2,7-dimethyl-10-(oxan-2-yloxy)deca-1,7-dien-3-yn-5-ol |
| PubChem CID | 14805456 |
| Molecular Formula | C17H26O3 |
| Molecular Weight | 278.39 g/mol |
| Exact Mass | 278.19 |
| IUPAC Name | (7E)-2,7-dimethyl-10-(oxan-2-yloxy)deca-1,7-dien-3-yn-5-ol |
| SMILES | C=C(C)C#CC(O)C/C(C)=C/CCOC1CCCCO1 |
| InChI | InChI=1S/C17H26O3/c1-14(2)9-10-16(18)13-15(3)7-6-12-20-17-8-4-5-11-19-17/h7,16-18H,1,4-6,8,11-13H2,2-3H3/b15-7+ |
| InChIKey | GTALRGCZKGTGPO-VIZOYTHASA-N |
| XLogP | 3.20 |
| TPSA | 38.69 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 20 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 278.39 |
| LogP ≤ 5 | 3.20 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'}, {'alert_name': 'triple_bond', 'substructure': 'N/A'} |
|---|
Analyze (7E)-2,7-dimethyl-10-(oxan-2-yloxy)deca-1,7-dien-3-yn-5-ol with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of (7E)-2,7-dimethyl-10-(oxan-2-yloxy)deca-1,7-dien-3-yn-5-ol?
The IUPAC name of (7E)-2,7-dimethyl-10-(oxan-2-yloxy)deca-1,7-dien-3-yn-5-ol (CID 14805456) is (7E)-2,7-dimethyl-10-(oxan-2-yloxy)deca-1,7-dien-3-yn-5-ol.
What is the SMILES notation for (7E)-2,7-dimethyl-10-(oxan-2-yloxy)deca-1,7-dien-3-yn-5-ol?
The canonical SMILES for (7E)-2,7-dimethyl-10-(oxan-2-yloxy)deca-1,7-dien-3-yn-5-ol is C=C(C)C#CC(O)C/C(C)=C/CCOC1CCCCO1.
What is the InChIKey of (7E)-2,7-dimethyl-10-(oxan-2-yloxy)deca-1,7-dien-3-yn-5-ol?
The InChIKey is GTALRGCZKGTGPO-VIZOYTHASA-N. The full InChI is InChI=1S/C17H26O3/c1-14(2)9-10-16(18)13-15(3)7-6-12-20-17-8-4-5-11-19-17/h7,16-18H,1,4-6,8,11-13H2,2-3H3/b15-7+.
What are the key properties of (7E)-2,7-dimethyl-10-(oxan-2-yloxy)deca-1,7-dien-3-yn-5-ol?
(7E)-2,7-dimethyl-10-(oxan-2-yloxy)deca-1,7-dien-3-yn-5-ol has a molecular weight of 278.39 g/mol, XLogP of 3.20, 6 rotatable bonds, 1 hydrogen bond donors, and 3 hydrogen bond acceptors.
Where does this data come from?
All data for (7E)-2,7-dimethyl-10-(oxan-2-yloxy)deca-1,7-dien-3-yn-5-ol is sourced from PubChem (CID 14805456), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).