C12H20O2 — CID 14805459
(3Z,7E)-4,9-dimethyldeca-3,7,9-triene-1,6-diol (PubChem CID 14805459) has the molecular formula C12H20O2 and a molecular weight of 196.29 g/mol. Its IUPAC name is (3Z,7E)-4,9-dimethyldeca-3,7,9-triene-1,6-diol.
| Compound Name | (3Z,7E)-4,9-dimethyldeca-3,7,9-triene-1,6-diol |
|---|---|
| PubChem CID | 14805459 |
| Molecular Formula | C12H20O2 |
| Molecular Weight | 196.29 g/mol |
| Exact Mass | 196.15 |
| IUPAC Name | (3Z,7E)-4,9-dimethyldeca-3,7,9-triene-1,6-diol |
| SMILES | C=C(C)/C=C/C(O)C/C(C)=C\CCO |
| InChI | InChI=1S/C12H20O2/c1-10(2)6-7-12(14)9-11(3)5-4-8-13/h5-7,12-14H,1,4,8-9H2,2-3H3/b7-6+,11-5- |
| InChIKey | CVMVZORRNMYSKA-WCFMJWFXSA-N |
| XLogP | 2.20 |
| TPSA | 40.46 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 14 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 196.29 |
| LogP ≤ 5 | 2.20 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'}, {'alert_name': 'polyene', 'substructure': 'N/A'} |
|---|