About (2R,4S)-4-methyl-2-[(1E)-3-methylbuta-1,3-dienyl]oxepane
(2R,4S)-4-methyl-2-[(1E)-3-methylbuta-1,3-dienyl]oxepane (PubChem CID 14805471) has the molecular formula C12H20O
and a molecular weight of 180.29 g/mol. Its IUPAC name is (2R,4S)-4-methyl-2-[(1E)-3-methylbuta-1,3-dienyl]oxepane.
Molecular Properties
| Compound Name | (2R,4S)-4-methyl-2-[(1E)-3-methylbuta-1,3-dienyl]oxepane |
| PubChem CID | 14805471 |
| Molecular Formula | C12H20O |
| Molecular Weight | 180.29 g/mol |
| Exact Mass | 180.15 |
| IUPAC Name | (2R,4S)-4-methyl-2-[(1E)-3-methylbuta-1,3-dienyl]oxepane |
| SMILES | C=C(C)/C=C/[C@H]1C[C@@H](C)CCCO1 |
| InChI | InChI=1S/C12H20O/c1-10(2)6-7-12-9-11(3)5-4-8-13-12/h6-7,11-12H,1,4-5,8-9H2,2-3H3/b7-6+/t11-,12-/m0/s1 |
| InChIKey | RLBHQLPVVYXAQJ-KZQRZKTQSA-N |
| XLogP | 3.32 |
| TPSA | 9.23 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 13 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 180.29 |
| LogP ≤ 5 | 3.32 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 1 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'polyene', 'substructure': 'N/A'} |
|---|
Analyze (2R,4S)-4-methyl-2-[(1E)-3-methylbuta-1,3-dienyl]oxepane with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of (2R,4S)-4-methyl-2-[(1E)-3-methylbuta-1,3-dienyl]oxepane?
The IUPAC name of (2R,4S)-4-methyl-2-[(1E)-3-methylbuta-1,3-dienyl]oxepane (CID 14805471) is (2R,4S)-4-methyl-2-[(1E)-3-methylbuta-1,3-dienyl]oxepane.
What is the SMILES notation for (2R,4S)-4-methyl-2-[(1E)-3-methylbuta-1,3-dienyl]oxepane?
The canonical SMILES for (2R,4S)-4-methyl-2-[(1E)-3-methylbuta-1,3-dienyl]oxepane is C=C(C)/C=C/[C@H]1C[C@@H](C)CCCO1.
What is the InChIKey of (2R,4S)-4-methyl-2-[(1E)-3-methylbuta-1,3-dienyl]oxepane?
The InChIKey is RLBHQLPVVYXAQJ-KZQRZKTQSA-N. The full InChI is InChI=1S/C12H20O/c1-10(2)6-7-12-9-11(3)5-4-8-13-12/h6-7,11-12H,1,4-5,8-9H2,2-3H3/b7-6+/t11-,12-/m0/s1.
What are the key properties of (2R,4S)-4-methyl-2-[(1E)-3-methylbuta-1,3-dienyl]oxepane?
(2R,4S)-4-methyl-2-[(1E)-3-methylbuta-1,3-dienyl]oxepane has a molecular weight of 180.29 g/mol, XLogP of 3.32, 2 rotatable bonds, 0 hydrogen bond donors, and 1 hydrogen bond acceptors.
Where does this data come from?
All data for (2R,4S)-4-methyl-2-[(1E)-3-methylbuta-1,3-dienyl]oxepane is sourced from PubChem (CID 14805471), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).