C21H34O5 — CID 14805937
(1S,2R,5S,6R,7R,8R,12S,13R)-10-[(2S)-1-hydroxypropan-2-yl]-2-(methoxymethyl)-6,13-dimethyl-15-oxatetracyclo[10.2.1.01,5.09,13]pentadec-9-ene-7,8-diol (PubChem CID 14805937) has the molecular formula C21H34O5 and a molecular weight of 366.50 g/mol. Its IUPAC name is (1S,2R,5S,6R,7R,8R,12S,13R)-10-[(2S)-1-hydroxypropan-2-yl]-2-(methoxymethyl)-6,13-dimethyl-15-oxatetracyclo[10.2.1.01,5.09,13]pentadec-9-ene-7,8-diol.
| Compound Name | (1S,2R,5S,6R,7R,8R,12S,13R)-10-[(2S)-1-hydroxypropan-2-yl]-2-(methoxymethyl)-6,13-dimethyl-15-oxatetracyclo[10.2.1.01,5.09,13]pentadec-9-ene-7,8-diol |
|---|---|
| PubChem CID | 14805937 |
| Molecular Formula | C21H34O5 |
| Molecular Weight | 366.50 g/mol |
| Exact Mass | 366.24 |
| IUPAC Name | (1S,2R,5S,6R,7R,8R,12S,13R)-10-[(2S)-1-hydroxypropan-2-yl]-2-(methoxymethyl)-6,13-dimethyl-15-oxatetracyclo[10.2.1.01,5.09,13]pentadec-9-ene-7,8-diol |
| SMILES | COC[C@H]1CC[C@H]2[C@@H](C)[C@@H](O)[C@H](O)C3=C([C@H](C)CO)C[C@@H]4O[C@]12C[C@]34C |
| InChI | InChI=1S/C21H34O5/c1-11(8-22)14-7-16-20(3)10-21(26-16)13(9-25-4)5-6-15(21)12(2)18(23)19(24)17(14)20/h11-13,15-16,18-19,22-24H,5-10H2,1-4H3/t11-,12-,13-,15+,16+,18-,19-,20+,21-/m1/s1 |
| InChIKey | OFKHXVREQYIRJP-GXYDYFPESA-N |
| XLogP | 1.89 |
| TPSA | 79.15 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 366.50 |
| LogP ≤ 5 | 1.89 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|