About 2-methyl-5-nitro-1,2,4-triazole-3-carboxylic acid
2-methyl-5-nitro-1,2,4-triazole-3-carboxylic acid (PubChem CID 14806194) has the molecular formula C4H4N4O4
and a molecular weight of 172.10 g/mol. Its IUPAC name is 2-methyl-5-nitro-1,2,4-triazole-3-carboxylic acid.
Molecular Properties
| Compound Name | 2-methyl-5-nitro-1,2,4-triazole-3-carboxylic acid |
| PubChem CID | 14806194 |
| Molecular Formula | C4H4N4O4 |
| Molecular Weight | 172.10 g/mol |
| Exact Mass | 172.02 |
| IUPAC Name | 2-methyl-5-nitro-1,2,4-triazole-3-carboxylic acid |
| SMILES | Cn1nc([N+](=O)[O-])nc1C(=O)O |
| InChI | InChI=1S/C4H4N4O4/c1-7-2(3(9)10)5-4(6-7)8(11)12/h1H3,(H,9,10) |
| InChIKey | PWQDUMIGDCFWEH-UHFFFAOYSA-N |
| XLogP | -0.58 |
| TPSA | 111.15 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 12 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 172.10 |
| LogP ≤ 5 | -0.58 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|
Analyze 2-methyl-5-nitro-1,2,4-triazole-3-carboxylic acid with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 2-methyl-5-nitro-1,2,4-triazole-3-carboxylic acid?
The IUPAC name of 2-methyl-5-nitro-1,2,4-triazole-3-carboxylic acid (CID 14806194) is 2-methyl-5-nitro-1,2,4-triazole-3-carboxylic acid.
What is the SMILES notation for 2-methyl-5-nitro-1,2,4-triazole-3-carboxylic acid?
The canonical SMILES for 2-methyl-5-nitro-1,2,4-triazole-3-carboxylic acid is Cn1nc([N+](=O)[O-])nc1C(=O)O.
What is the InChIKey of 2-methyl-5-nitro-1,2,4-triazole-3-carboxylic acid?
The InChIKey is PWQDUMIGDCFWEH-UHFFFAOYSA-N. The full InChI is InChI=1S/C4H4N4O4/c1-7-2(3(9)10)5-4(6-7)8(11)12/h1H3,(H,9,10).
What are the key properties of 2-methyl-5-nitro-1,2,4-triazole-3-carboxylic acid?
2-methyl-5-nitro-1,2,4-triazole-3-carboxylic acid has a molecular weight of 172.10 g/mol, XLogP of -0.58, 2 rotatable bonds, 1 hydrogen bond donors, and 6 hydrogen bond acceptors.
Where does this data come from?
All data for 2-methyl-5-nitro-1,2,4-triazole-3-carboxylic acid is sourced from PubChem (CID 14806194), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).