C22H34O5 — CID 14806456
[(1R,2E,4S,10Z,13R,14R,16R)-14-hydroxy-6-oxo-4-pentyl-5-oxabicyclo[11.3.0]hexadeca-2,10-dien-16-yl] acetate (PubChem CID 14806456) has the molecular formula C22H34O5 and a molecular weight of 378.51 g/mol. Its IUPAC name is [(1R,2E,4S,10Z,13R,14R,16R)-14-hydroxy-6-oxo-4-pentyl-5-oxabicyclo[11.3.0]hexadeca-2,10-dien-16-yl] acetate.
| Compound Name | [(1R,2E,4S,10Z,13R,14R,16R)-14-hydroxy-6-oxo-4-pentyl-5-oxabicyclo[11.3.0]hexadeca-2,10-dien-16-yl] acetate |
|---|---|
| PubChem CID | 14806456 |
| Molecular Formula | C22H34O5 |
| Molecular Weight | 378.51 g/mol |
| Exact Mass | 378.24 |
| IUPAC Name | [(1R,2E,4S,10Z,13R,14R,16R)-14-hydroxy-6-oxo-4-pentyl-5-oxabicyclo[11.3.0]hexadeca-2,10-dien-16-yl] acetate |
| SMILES | CCCCC[C@H]1/C=C/[C@@H]2[C@@H](C/C=C\CCCC(=O)O1)[C@H](O)C[C@H]2OC(C)=O |
| InChI | InChI=1S/C22H34O5/c1-3-4-7-10-17-13-14-19-18(20(24)15-21(19)26-16(2)23)11-8-5-6-9-12-22(25)27-17/h5,8,13-14,17-21,24H,3-4,6-7,9-12,15H2,1-2H3/b8-5-,14-13+/t17-,18+,19+,20+,21+/m0/s1 |
| InChIKey | DKLUJLHAYRSKSQ-QHSHEYJASA-N |
| XLogP | 4.09 |
| TPSA | 72.83 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 378.51 |
| LogP ≤ 5 | 4.09 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|