C18H30O8 — CID 14807523
[(2R,3R,4S,5S,6R)-4,5-dihydroxy-6-(hydroxymethyl)-2-[(E)-8-hydroxy-7-methyl-3-methylideneoct-6-enoxy]oxan-3-yl] acetate (PubChem CID 14807523) has the molecular formula C18H30O8 and a molecular weight of 374.43 g/mol. Its IUPAC name is [(2R,3R,4S,5S,6R)-4,5-dihydroxy-6-(hydroxymethyl)-2-[(E)-8-hydroxy-7-methyl-3-methylideneoct-6-enoxy]oxan-3-yl] acetate.
| Compound Name | [(2R,3R,4S,5S,6R)-4,5-dihydroxy-6-(hydroxymethyl)-2-[(E)-8-hydroxy-7-methyl-3-methylideneoct-6-enoxy]oxan-3-yl] acetate |
|---|---|
| PubChem CID | 14807523 |
| Molecular Formula | C18H30O8 |
| Molecular Weight | 374.43 g/mol |
| Exact Mass | 374.19 |
| IUPAC Name | [(2R,3R,4S,5S,6R)-4,5-dihydroxy-6-(hydroxymethyl)-2-[(E)-8-hydroxy-7-methyl-3-methylideneoct-6-enoxy]oxan-3-yl] acetate |
| SMILES | C=C(CC/C=C(\C)CO)CCO[C@@H]1O[C@H](CO)[C@@H](O)[C@H](O)[C@H]1OC(C)=O |
| InChI | InChI=1S/C18H30O8/c1-11(5-4-6-12(2)9-19)7-8-24-18-17(25-13(3)21)16(23)15(22)14(10-20)26-18/h6,14-20,22-23H,1,4-5,7-10H2,2-3H3/b12-6+/t14-,15-,16+,17-,18-/m1/s1 |
| InChIKey | VQHOSDHGUCVYFU-GGVCVCSLSA-N |
| XLogP | 0.04 |
| TPSA | 125.68 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 374.43 |
| LogP ≤ 5 | 0.04 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|