C20H32O9 — CID 14807525
[(2R,3S,4S,5R,6R)-5-acetyloxy-3,4-dihydroxy-6-[(E)-8-hydroxy-7-methyl-3-methylideneoct-6-enoxy]oxan-2-yl]methyl acetate (PubChem CID 14807525) has the molecular formula C20H32O9 and a molecular weight of 416.47 g/mol. Its IUPAC name is [(2R,3S,4S,5R,6R)-5-acetyloxy-3,4-dihydroxy-6-[(E)-8-hydroxy-7-methyl-3-methylideneoct-6-enoxy]oxan-2-yl]methyl acetate.
| Compound Name | [(2R,3S,4S,5R,6R)-5-acetyloxy-3,4-dihydroxy-6-[(E)-8-hydroxy-7-methyl-3-methylideneoct-6-enoxy]oxan-2-yl]methyl acetate |
|---|---|
| PubChem CID | 14807525 |
| Molecular Formula | C20H32O9 |
| Molecular Weight | 416.47 g/mol |
| Exact Mass | 416.20 |
| IUPAC Name | [(2R,3S,4S,5R,6R)-5-acetyloxy-3,4-dihydroxy-6-[(E)-8-hydroxy-7-methyl-3-methylideneoct-6-enoxy]oxan-2-yl]methyl acetate |
| SMILES | C=C(CC/C=C(\C)CO)CCO[C@@H]1O[C@H](COC(C)=O)[C@@H](O)[C@H](O)[C@H]1OC(C)=O |
| InChI | InChI=1S/C20H32O9/c1-12(6-5-7-13(2)10-21)8-9-26-20-19(28-15(4)23)18(25)17(24)16(29-20)11-27-14(3)22/h7,16-21,24-25H,1,5-6,8-11H2,2-4H3/b13-7+/t16-,17-,18+,19-,20-/m1/s1 |
| InChIKey | YICCDWNSZGHVRH-BULRUFHISA-N |
| XLogP | 0.61 |
| TPSA | 131.75 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 9 |
| Rotatable Bonds | 11 |
| Heavy Atoms | 29 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 416.47 |
| LogP ≤ 5 | 0.61 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 9 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|