C20H32O8 — CID 14807527
[(2R,3S,4S,5R,6R)-5-acetyloxy-3,4-dihydroxy-6-(7-methyl-3-methylideneoct-6-enoxy)oxan-2-yl]methyl acetate (PubChem CID 14807527) has the molecular formula C20H32O8 and a molecular weight of 400.47 g/mol. Its IUPAC name is [(2R,3S,4S,5R,6R)-5-acetyloxy-3,4-dihydroxy-6-(7-methyl-3-methylideneoct-6-enoxy)oxan-2-yl]methyl acetate.
| Compound Name | [(2R,3S,4S,5R,6R)-5-acetyloxy-3,4-dihydroxy-6-(7-methyl-3-methylideneoct-6-enoxy)oxan-2-yl]methyl acetate |
|---|---|
| PubChem CID | 14807527 |
| Molecular Formula | C20H32O8 |
| Molecular Weight | 400.47 g/mol |
| Exact Mass | 400.21 |
| IUPAC Name | [(2R,3S,4S,5R,6R)-5-acetyloxy-3,4-dihydroxy-6-(7-methyl-3-methylideneoct-6-enoxy)oxan-2-yl]methyl acetate |
| SMILES | C=C(CCC=C(C)C)CCO[C@@H]1O[C@H](COC(C)=O)[C@@H](O)[C@H](O)[C@H]1OC(C)=O |
| InChI | InChI=1S/C20H32O8/c1-12(2)7-6-8-13(3)9-10-25-20-19(27-15(5)22)18(24)17(23)16(28-20)11-26-14(4)21/h7,16-20,23-24H,3,6,8-11H2,1-2,4-5H3/t16-,17-,18+,19-,20-/m1/s1 |
| InChIKey | YRYNFWXCIFYHLE-OUUBHVDSSA-N |
| XLogP | 1.64 |
| TPSA | 111.52 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 28 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 400.47 |
| LogP ≤ 5 | 1.64 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|