About 1,3-dimethyl-8-propan-2-yltricyclo[4.4.0.02,7]decan-3-ol
1,3-dimethyl-8-propan-2-yltricyclo[4.4.0.02,7]decan-3-ol (PubChem CID 14807649) has the molecular formula C15H26O
and a molecular weight of 222.37 g/mol. Its IUPAC name is 1,3-dimethyl-8-propan-2-yltricyclo[4.4.0.02,7]decan-3-ol.
Analyze 1,3-dimethyl-8-propan-2-yltricyclo[4.4.0.02,7]decan-3-ol with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 1,3-dimethyl-8-propan-2-yltricyclo[4.4.0.02,7]decan-3-ol?
The IUPAC name of 1,3-dimethyl-8-propan-2-yltricyclo[4.4.0.02,7]decan-3-ol (CID 14807649) is 1,3-dimethyl-8-propan-2-yltricyclo[4.4.0.02,7]decan-3-ol.
What is the SMILES notation for 1,3-dimethyl-8-propan-2-yltricyclo[4.4.0.02,7]decan-3-ol?
The canonical SMILES for 1,3-dimethyl-8-propan-2-yltricyclo[4.4.0.02,7]decan-3-ol is CC(C)C1CCC2(C)C3CCC(C)(O)C2C13.
What is the InChIKey of 1,3-dimethyl-8-propan-2-yltricyclo[4.4.0.02,7]decan-3-ol?
The InChIKey is AZCJPMYIWXNBMH-UHFFFAOYSA-N. The full InChI is InChI=1S/C15H26O/c1-9(2)10-5-7-14(3)11-6-8-15(4,16)13(14)12(10)11/h9-13,16H,5-8H2,1-4H3.
What are the key properties of 1,3-dimethyl-8-propan-2-yltricyclo[4.4.0.02,7]decan-3-ol?
1,3-dimethyl-8-propan-2-yltricyclo[4.4.0.02,7]decan-3-ol has a molecular weight of 222.37 g/mol, XLogP of 3.47, 1 rotatable bonds, 1 hydrogen bond donors, and 1 hydrogen bond acceptors.
Where does this data come from?
All data for 1,3-dimethyl-8-propan-2-yltricyclo[4.4.0.02,7]decan-3-ol is sourced from PubChem (CID 14807649), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).