About 7-[3-(5-phenyl-3,6-dihydro-2H-pyridin-1-yl)propoxy]chromen-4-one
7-[3-(5-phenyl-3,6-dihydro-2H-pyridin-1-yl)propoxy]chromen-4-one (PubChem CID 14809092) has the molecular formula C23H23NO3
and a molecular weight of 361.44 g/mol. Its IUPAC name is 7-[3-(5-phenyl-3,6-dihydro-2H-pyridin-1-yl)propoxy]chromen-4-one.
Molecular Properties
| Compound Name | 7-[3-(5-phenyl-3,6-dihydro-2H-pyridin-1-yl)propoxy]chromen-4-one |
| PubChem CID | 14809092 |
| Molecular Formula | C23H23NO3 |
| Molecular Weight | 361.44 g/mol |
| Exact Mass | 361.17 |
| IUPAC Name | 7-[3-(5-phenyl-3,6-dihydro-2H-pyridin-1-yl)propoxy]chromen-4-one |
| SMILES | O=c1ccoc2cc(OCCCN3CCC=C(c4ccccc4)C3)ccc12 |
| InChI | InChI=1S/C23H23NO3/c25-22-11-15-27-23-16-20(9-10-21(22)23)26-14-5-13-24-12-4-8-19(17-24)18-6-2-1-3-7-18/h1-3,6-11,15-16H,4-5,12-14,17H2 |
| InChIKey | YFZYSMRUADKWEO-UHFFFAOYSA-N |
| XLogP | 4.35 |
| TPSA | 42.68 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 27 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 361.44 |
| LogP ≤ 5 | 4.35 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|
Analyze 7-[3-(5-phenyl-3,6-dihydro-2H-pyridin-1-yl)propoxy]chromen-4-one with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 7-[3-(5-phenyl-3,6-dihydro-2H-pyridin-1-yl)propoxy]chromen-4-one?
The IUPAC name of 7-[3-(5-phenyl-3,6-dihydro-2H-pyridin-1-yl)propoxy]chromen-4-one (CID 14809092) is 7-[3-(5-phenyl-3,6-dihydro-2H-pyridin-1-yl)propoxy]chromen-4-one.
What is the SMILES notation for 7-[3-(5-phenyl-3,6-dihydro-2H-pyridin-1-yl)propoxy]chromen-4-one?
The canonical SMILES for 7-[3-(5-phenyl-3,6-dihydro-2H-pyridin-1-yl)propoxy]chromen-4-one is O=c1ccoc2cc(OCCCN3CCC=C(c4ccccc4)C3)ccc12.
What is the InChIKey of 7-[3-(5-phenyl-3,6-dihydro-2H-pyridin-1-yl)propoxy]chromen-4-one?
The InChIKey is YFZYSMRUADKWEO-UHFFFAOYSA-N. The full InChI is InChI=1S/C23H23NO3/c25-22-11-15-27-23-16-20(9-10-21(22)23)26-14-5-13-24-12-4-8-19(17-24)18-6-2-1-3-7-18/h1-3,6-11,15-16H,4-5,12-14,17H2.
What are the key properties of 7-[3-(5-phenyl-3,6-dihydro-2H-pyridin-1-yl)propoxy]chromen-4-one?
7-[3-(5-phenyl-3,6-dihydro-2H-pyridin-1-yl)propoxy]chromen-4-one has a molecular weight of 361.44 g/mol, XLogP of 4.35, 6 rotatable bonds, 0 hydrogen bond donors, and 4 hydrogen bond acceptors.
Where does this data come from?
All data for 7-[3-(5-phenyl-3,6-dihydro-2H-pyridin-1-yl)propoxy]chromen-4-one is sourced from PubChem (CID 14809092), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).