About methyl 7-chlorothieno[3,2-b]pyridine-6-carboxylate
methyl 7-chlorothieno[3,2-b]pyridine-6-carboxylate (PubChem CID 14809182) has the molecular formula C9H6ClNO2S
and a molecular weight of 227.67 g/mol. Its IUPAC name is methyl 7-chlorothieno[3,2-b]pyridine-6-carboxylate.
Molecular Properties
| Compound Name | methyl 7-chlorothieno[3,2-b]pyridine-6-carboxylate |
| PubChem CID | 14809182 |
| Molecular Formula | C9H6ClNO2S |
| Molecular Weight | 227.67 g/mol |
| Exact Mass | 226.98 |
| IUPAC Name | methyl 7-chlorothieno[3,2-b]pyridine-6-carboxylate |
| SMILES | COC(=O)c1cnc2ccsc2c1Cl |
| InChI | InChI=1S/C9H6ClNO2S/c1-13-9(12)5-4-11-6-2-3-14-8(6)7(5)10/h2-4H,1H3 |
| InChIKey | XMAAPCRARDHOKI-UHFFFAOYSA-N |
| XLogP | 2.74 |
| TPSA | 39.19 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 14 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 227.67 |
| LogP ≤ 5 | 2.74 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
Analyze methyl 7-chlorothieno[3,2-b]pyridine-6-carboxylate with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of methyl 7-chlorothieno[3,2-b]pyridine-6-carboxylate?
The IUPAC name of methyl 7-chlorothieno[3,2-b]pyridine-6-carboxylate (CID 14809182) is methyl 7-chlorothieno[3,2-b]pyridine-6-carboxylate.
What is the SMILES notation for methyl 7-chlorothieno[3,2-b]pyridine-6-carboxylate?
The canonical SMILES for methyl 7-chlorothieno[3,2-b]pyridine-6-carboxylate is COC(=O)c1cnc2ccsc2c1Cl.
What is the InChIKey of methyl 7-chlorothieno[3,2-b]pyridine-6-carboxylate?
The InChIKey is XMAAPCRARDHOKI-UHFFFAOYSA-N. The full InChI is InChI=1S/C9H6ClNO2S/c1-13-9(12)5-4-11-6-2-3-14-8(6)7(5)10/h2-4H,1H3.
What are the key properties of methyl 7-chlorothieno[3,2-b]pyridine-6-carboxylate?
methyl 7-chlorothieno[3,2-b]pyridine-6-carboxylate has a molecular weight of 227.67 g/mol, XLogP of 2.74, 1 rotatable bonds, 0 hydrogen bond donors, and 4 hydrogen bond acceptors.
Where does this data come from?
All data for methyl 7-chlorothieno[3,2-b]pyridine-6-carboxylate is sourced from PubChem (CID 14809182), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).