C14H8ClN3OS — CID 14809208
4-(4-chlorophenyl)-12-thia-3,4,8-triazatricyclo[7.3.0.02,6]dodeca-1,6,8,10-tetraen-5-one (PubChem CID 14809208) has the molecular formula C14H8ClN3OS and a molecular weight of 301.76 g/mol. Its IUPAC name is 4-(4-chlorophenyl)-12-thia-3,4,8-triazatricyclo[7.3.0.02,6]dodeca-1,6,8,10-tetraen-5-one.
| Compound Name | 4-(4-chlorophenyl)-12-thia-3,4,8-triazatricyclo[7.3.0.02,6]dodeca-1,6,8,10-tetraen-5-one |
|---|---|
| PubChem CID | 14809208 |
| Molecular Formula | C14H8ClN3OS |
| Molecular Weight | 301.76 g/mol |
| Exact Mass | 301.01 |
| IUPAC Name | 4-(4-chlorophenyl)-12-thia-3,4,8-triazatricyclo[7.3.0.02,6]dodeca-1,6,8,10-tetraen-5-one |
| SMILES | O=c1c2cnc3ccsc3c2[nH]n1-c1ccc(Cl)cc1 |
| InChI | InChI=1S/C14H8ClN3OS/c15-8-1-3-9(4-2-8)18-14(19)10-7-16-11-5-6-20-13(11)12(10)17-18/h1-7,17H |
| InChIKey | AEIDFGKPWBMJRB-UHFFFAOYSA-N |
| XLogP | 3.58 |
| TPSA | 50.68 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 301.76 |
| LogP ≤ 5 | 3.58 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'het_65_B(7)', 'substructure': 'N/A'} |
|---|