C15H10ClN3OS — CID 14809215
4-(4-chlorophenyl)-3-methyl-12-thia-3,4,8-triazatricyclo[7.3.0.02,6]dodeca-1,6,8,10-tetraen-5-one (PubChem CID 14809215) has the molecular formula C15H10ClN3OS and a molecular weight of 315.79 g/mol. Its IUPAC name is 4-(4-chlorophenyl)-3-methyl-12-thia-3,4,8-triazatricyclo[7.3.0.02,6]dodeca-1,6,8,10-tetraen-5-one.
| Compound Name | 4-(4-chlorophenyl)-3-methyl-12-thia-3,4,8-triazatricyclo[7.3.0.02,6]dodeca-1,6,8,10-tetraen-5-one |
|---|---|
| PubChem CID | 14809215 |
| Molecular Formula | C15H10ClN3OS |
| Molecular Weight | 315.79 g/mol |
| Exact Mass | 315.02 |
| IUPAC Name | 4-(4-chlorophenyl)-3-methyl-12-thia-3,4,8-triazatricyclo[7.3.0.02,6]dodeca-1,6,8,10-tetraen-5-one |
| SMILES | Cn1c2c(cnc3ccsc32)c(=O)n1-c1ccc(Cl)cc1 |
| InChI | InChI=1S/C15H10ClN3OS/c1-18-13-11(8-17-12-6-7-21-14(12)13)15(20)19(18)10-4-2-9(16)3-5-10/h2-8H,1H3 |
| InChIKey | DSVXKHSWGYIQJM-UHFFFAOYSA-N |
| XLogP | 3.59 |
| TPSA | 39.82 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 315.79 |
| LogP ≤ 5 | 3.59 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |