C14H7Cl2N3S — CID 14809216
5-chloro-4-(4-chlorophenyl)-12-thia-3,4,8-triazatricyclo[7.3.0.02,6]dodeca-1(9),2,5,7,10-pentaene (PubChem CID 14809216) has the molecular formula C14H7Cl2N3S and a molecular weight of 320.20 g/mol. Its IUPAC name is 5-chloro-4-(4-chlorophenyl)-12-thia-3,4,8-triazatricyclo[7.3.0.02,6]dodeca-1(9),2,5,7,10-pentaene.
| Compound Name | 5-chloro-4-(4-chlorophenyl)-12-thia-3,4,8-triazatricyclo[7.3.0.02,6]dodeca-1(9),2,5,7,10-pentaene |
|---|---|
| PubChem CID | 14809216 |
| Molecular Formula | C14H7Cl2N3S |
| Molecular Weight | 320.20 g/mol |
| Exact Mass | 318.97 |
| IUPAC Name | 5-chloro-4-(4-chlorophenyl)-12-thia-3,4,8-triazatricyclo[7.3.0.02,6]dodeca-1(9),2,5,7,10-pentaene |
| SMILES | Clc1ccc(-n2nc3c(cnc4ccsc43)c2Cl)cc1 |
| InChI | InChI=1S/C14H7Cl2N3S/c15-8-1-3-9(4-2-8)19-14(16)10-7-17-11-5-6-20-13(11)12(10)18-19/h1-7H |
| InChIKey | DXSUEGBXLBXIPI-UHFFFAOYSA-N |
| XLogP | 4.94 |
| TPSA | 30.71 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 320.20 |
| LogP ≤ 5 | 4.94 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |