C18H12ClN5O — CID 14809222
4-(4-chlorophenyl)-12-methyl-3,4,8,12,13-pentazatetracyclo[7.7.0.02,6.011,15]hexadeca-1,6,8,10,13,15-hexaen-5-one (PubChem CID 14809222) has the molecular formula C18H12ClN5O and a molecular weight of 349.78 g/mol. Its IUPAC name is 4-(4-chlorophenyl)-12-methyl-3,4,8,12,13-pentazatetracyclo[7.7.0.02,6.011,15]hexadeca-1,6,8,10,13,15-hexaen-5-one.
| Compound Name | 4-(4-chlorophenyl)-12-methyl-3,4,8,12,13-pentazatetracyclo[7.7.0.02,6.011,15]hexadeca-1,6,8,10,13,15-hexaen-5-one |
|---|---|
| PubChem CID | 14809222 |
| Molecular Formula | C18H12ClN5O |
| Molecular Weight | 349.78 g/mol |
| Exact Mass | 349.07 |
| IUPAC Name | 4-(4-chlorophenyl)-12-methyl-3,4,8,12,13-pentazatetracyclo[7.7.0.02,6.011,15]hexadeca-1,6,8,10,13,15-hexaen-5-one |
| SMILES | Cn1ncc2cc3c(cc21)ncc1c(=O)n(-c2ccc(Cl)cc2)[nH]c13 |
| InChI | InChI=1S/C18H12ClN5O/c1-23-16-7-15-13(6-10(16)8-21-23)17-14(9-20-15)18(25)24(22-17)12-4-2-11(19)3-5-12/h2-9,22H,1H3 |
| InChIKey | LAXFXRAJDAWLMA-UHFFFAOYSA-N |
| XLogP | 3.41 |
| TPSA | 68.50 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 349.78 |
| LogP ≤ 5 | 3.41 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'het_65_B(7)', 'substructure': 'N/A'} |
|---|