About quinolin-8-ylthiourea
quinolin-8-ylthiourea (PubChem CID 1480923) has the molecular formula C10H9N3S
and a molecular weight of 203.27 g/mol. Its IUPAC name is quinolin-8-ylthiourea.
Molecular Properties
| Compound Name | quinolin-8-ylthiourea |
| PubChem CID | 1480923 |
| Molecular Formula | C10H9N3S |
| Molecular Weight | 203.27 g/mol |
| Exact Mass | 203.05 |
| IUPAC Name | quinolin-8-ylthiourea |
| SMILES | NC(=S)Nc1cccc2cccnc12 |
| InChI | InChI=1S/C10H9N3S/c11-10(14)13-8-5-1-3-7-4-2-6-12-9(7)8/h1-6H,(H3,11,13,14) |
| InChIKey | FPTWSXFODBCVFM-UHFFFAOYSA-N |
| XLogP | 1.89 |
| TPSA | 50.94 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 14 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 203.27 |
| LogP ≤ 5 | 1.89 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 2 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'Thiocarbonyl_group', 'substructure': 'N/A'} |
|---|
Analyze quinolin-8-ylthiourea with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of quinolin-8-ylthiourea?
The IUPAC name of quinolin-8-ylthiourea (CID 1480923) is quinolin-8-ylthiourea.
What is the SMILES notation for quinolin-8-ylthiourea?
The canonical SMILES for quinolin-8-ylthiourea is NC(=S)Nc1cccc2cccnc12.
What is the InChIKey of quinolin-8-ylthiourea?
The InChIKey is FPTWSXFODBCVFM-UHFFFAOYSA-N. The full InChI is InChI=1S/C10H9N3S/c11-10(14)13-8-5-1-3-7-4-2-6-12-9(7)8/h1-6H,(H3,11,13,14).
What are the key properties of quinolin-8-ylthiourea?
quinolin-8-ylthiourea has a molecular weight of 203.27 g/mol, XLogP of 1.89, 1 rotatable bonds, 2 hydrogen bond donors, and 2 hydrogen bond acceptors.
Where does this data come from?
All data for quinolin-8-ylthiourea is sourced from PubChem (CID 1480923), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).