About (4-methoxy-6,6-dimethyl-2-oxocyclohex-3-en-1-yl) 2-chloropropanoate
(4-methoxy-6,6-dimethyl-2-oxocyclohex-3-en-1-yl) 2-chloropropanoate (PubChem CID 14810167) has the molecular formula C12H17ClO4
and a molecular weight of 260.72 g/mol. Its IUPAC name is (4-methoxy-6,6-dimethyl-2-oxocyclohex-3-en-1-yl) 2-chloropropanoate.
Molecular Properties
| Compound Name | (4-methoxy-6,6-dimethyl-2-oxocyclohex-3-en-1-yl) 2-chloropropanoate |
| PubChem CID | 14810167 |
| Molecular Formula | C12H17ClO4 |
| Molecular Weight | 260.72 g/mol |
| Exact Mass | 260.08 |
| IUPAC Name | (4-methoxy-6,6-dimethyl-2-oxocyclohex-3-en-1-yl) 2-chloropropanoate |
| SMILES | COC1=CC(=O)C(OC(=O)C(C)Cl)C(C)(C)C1 |
| InChI | InChI=1S/C12H17ClO4/c1-7(13)11(15)17-10-9(14)5-8(16-4)6-12(10,2)3/h5,7,10H,6H2,1-4H3 |
| InChIKey | JXKCFOHMCCKEMM-UHFFFAOYSA-N |
| XLogP | 2.05 |
| TPSA | 52.60 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 17 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 260.72 |
| LogP ≤ 5 | 2.05 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'alkyl_halide', 'substructure': 'N/A'} |
|---|
Analyze (4-methoxy-6,6-dimethyl-2-oxocyclohex-3-en-1-yl) 2-chloropropanoate with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of (4-methoxy-6,6-dimethyl-2-oxocyclohex-3-en-1-yl) 2-chloropropanoate?
The IUPAC name of (4-methoxy-6,6-dimethyl-2-oxocyclohex-3-en-1-yl) 2-chloropropanoate (CID 14810167) is (4-methoxy-6,6-dimethyl-2-oxocyclohex-3-en-1-yl) 2-chloropropanoate.
What is the SMILES notation for (4-methoxy-6,6-dimethyl-2-oxocyclohex-3-en-1-yl) 2-chloropropanoate?
The canonical SMILES for (4-methoxy-6,6-dimethyl-2-oxocyclohex-3-en-1-yl) 2-chloropropanoate is COC1=CC(=O)C(OC(=O)C(C)Cl)C(C)(C)C1.
What is the InChIKey of (4-methoxy-6,6-dimethyl-2-oxocyclohex-3-en-1-yl) 2-chloropropanoate?
The InChIKey is JXKCFOHMCCKEMM-UHFFFAOYSA-N. The full InChI is InChI=1S/C12H17ClO4/c1-7(13)11(15)17-10-9(14)5-8(16-4)6-12(10,2)3/h5,7,10H,6H2,1-4H3.
What are the key properties of (4-methoxy-6,6-dimethyl-2-oxocyclohex-3-en-1-yl) 2-chloropropanoate?
(4-methoxy-6,6-dimethyl-2-oxocyclohex-3-en-1-yl) 2-chloropropanoate has a molecular weight of 260.72 g/mol, XLogP of 2.05, 3 rotatable bonds, 0 hydrogen bond donors, and 4 hydrogen bond acceptors.
Where does this data come from?
All data for (4-methoxy-6,6-dimethyl-2-oxocyclohex-3-en-1-yl) 2-chloropropanoate is sourced from PubChem (CID 14810167), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).