About 1-benzhydryloxy-3-(2,6-dimethylpiperidin-1-yl)propan-2-ol
1-benzhydryloxy-3-(2,6-dimethylpiperidin-1-yl)propan-2-ol (PubChem CID 14810467) has the molecular formula C23H31NO2
and a molecular weight of 353.51 g/mol. Its IUPAC name is 1-benzhydryloxy-3-(2,6-dimethylpiperidin-1-yl)propan-2-ol.
Molecular Properties
| Compound Name | 1-benzhydryloxy-3-(2,6-dimethylpiperidin-1-yl)propan-2-ol |
| PubChem CID | 14810467 |
| Molecular Formula | C23H31NO2 |
| Molecular Weight | 353.51 g/mol |
| Exact Mass | 353.24 |
| IUPAC Name | 1-benzhydryloxy-3-(2,6-dimethylpiperidin-1-yl)propan-2-ol |
| SMILES | CC1CCCC(C)N1CC(O)COC(c1ccccc1)c1ccccc1 |
| InChI | InChI=1S/C23H31NO2/c1-18-10-9-11-19(2)24(18)16-22(25)17-26-23(20-12-5-3-6-13-20)21-14-7-4-8-15-21/h3-8,12-15,18-19,22-23,25H,9-11,16-17H2,1-2H3 |
| InChIKey | JGCOVNBZGICBIO-UHFFFAOYSA-N |
| XLogP | 4.42 |
| TPSA | 32.70 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 26 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 353.51 |
| LogP ≤ 5 | 4.42 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
Analyze 1-benzhydryloxy-3-(2,6-dimethylpiperidin-1-yl)propan-2-ol with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 1-benzhydryloxy-3-(2,6-dimethylpiperidin-1-yl)propan-2-ol?
The IUPAC name of 1-benzhydryloxy-3-(2,6-dimethylpiperidin-1-yl)propan-2-ol (CID 14810467) is 1-benzhydryloxy-3-(2,6-dimethylpiperidin-1-yl)propan-2-ol.
What is the SMILES notation for 1-benzhydryloxy-3-(2,6-dimethylpiperidin-1-yl)propan-2-ol?
The canonical SMILES for 1-benzhydryloxy-3-(2,6-dimethylpiperidin-1-yl)propan-2-ol is CC1CCCC(C)N1CC(O)COC(c1ccccc1)c1ccccc1.
What is the InChIKey of 1-benzhydryloxy-3-(2,6-dimethylpiperidin-1-yl)propan-2-ol?
The InChIKey is JGCOVNBZGICBIO-UHFFFAOYSA-N. The full InChI is InChI=1S/C23H31NO2/c1-18-10-9-11-19(2)24(18)16-22(25)17-26-23(20-12-5-3-6-13-20)21-14-7-4-8-15-21/h3-8,12-15,18-19,22-23,25H,9-11,16-17H2,1-2H3.
What are the key properties of 1-benzhydryloxy-3-(2,6-dimethylpiperidin-1-yl)propan-2-ol?
1-benzhydryloxy-3-(2,6-dimethylpiperidin-1-yl)propan-2-ol has a molecular weight of 353.51 g/mol, XLogP of 4.42, 7 rotatable bonds, 1 hydrogen bond donors, and 3 hydrogen bond acceptors.
Where does this data come from?
All data for 1-benzhydryloxy-3-(2,6-dimethylpiperidin-1-yl)propan-2-ol is sourced from PubChem (CID 14810467), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).