About 2-(2,6-dimethylpiperidin-1-yl)-1,1-diphenylethanol
2-(2,6-dimethylpiperidin-1-yl)-1,1-diphenylethanol (PubChem CID 14810514) has the molecular formula C21H27NO
and a molecular weight of 309.45 g/mol. Its IUPAC name is 2-(2,6-dimethylpiperidin-1-yl)-1,1-diphenylethanol.
Molecular Properties
| Compound Name | 2-(2,6-dimethylpiperidin-1-yl)-1,1-diphenylethanol |
| PubChem CID | 14810514 |
| Molecular Formula | C21H27NO |
| Molecular Weight | 309.45 g/mol |
| Exact Mass | 309.21 |
| IUPAC Name | 2-(2,6-dimethylpiperidin-1-yl)-1,1-diphenylethanol |
| SMILES | CC1CCCC(C)N1CC(O)(c1ccccc1)c1ccccc1 |
| InChI | InChI=1S/C21H27NO/c1-17-10-9-11-18(2)22(17)16-21(23,19-12-5-3-6-13-19)20-14-7-4-8-15-20/h3-8,12-15,17-18,23H,9-11,16H2,1-2H3 |
| InChIKey | NDRYSTVDBKVIRV-UHFFFAOYSA-N |
| XLogP | 4.19 |
| TPSA | 23.47 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 23 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 309.45 |
| LogP ≤ 5 | 4.19 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
Analyze 2-(2,6-dimethylpiperidin-1-yl)-1,1-diphenylethanol with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 2-(2,6-dimethylpiperidin-1-yl)-1,1-diphenylethanol?
The IUPAC name of 2-(2,6-dimethylpiperidin-1-yl)-1,1-diphenylethanol (CID 14810514) is 2-(2,6-dimethylpiperidin-1-yl)-1,1-diphenylethanol.
What is the SMILES notation for 2-(2,6-dimethylpiperidin-1-yl)-1,1-diphenylethanol?
The canonical SMILES for 2-(2,6-dimethylpiperidin-1-yl)-1,1-diphenylethanol is CC1CCCC(C)N1CC(O)(c1ccccc1)c1ccccc1.
What is the InChIKey of 2-(2,6-dimethylpiperidin-1-yl)-1,1-diphenylethanol?
The InChIKey is NDRYSTVDBKVIRV-UHFFFAOYSA-N. The full InChI is InChI=1S/C21H27NO/c1-17-10-9-11-18(2)22(17)16-21(23,19-12-5-3-6-13-19)20-14-7-4-8-15-20/h3-8,12-15,17-18,23H,9-11,16H2,1-2H3.
What are the key properties of 2-(2,6-dimethylpiperidin-1-yl)-1,1-diphenylethanol?
2-(2,6-dimethylpiperidin-1-yl)-1,1-diphenylethanol has a molecular weight of 309.45 g/mol, XLogP of 4.19, 4 rotatable bonds, 1 hydrogen bond donors, and 2 hydrogen bond acceptors.
Where does this data come from?
All data for 2-(2,6-dimethylpiperidin-1-yl)-1,1-diphenylethanol is sourced from PubChem (CID 14810514), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).