C9H10ClFN2OS — CID 14810665
S-(2-amino-6-chloro-4-fluorophenyl) N,N-dimethylcarbamothioate (PubChem CID 14810665) has the molecular formula C9H10ClFN2OS and a molecular weight of 248.71 g/mol. Its IUPAC name is S-(2-amino-6-chloro-4-fluorophenyl) N,N-dimethylcarbamothioate.
| Compound Name | S-(2-amino-6-chloro-4-fluorophenyl) N,N-dimethylcarbamothioate |
|---|---|
| PubChem CID | 14810665 |
| Molecular Formula | C9H10ClFN2OS |
| Molecular Weight | 248.71 g/mol |
| Exact Mass | 248.02 |
| IUPAC Name | S-(2-amino-6-chloro-4-fluorophenyl) N,N-dimethylcarbamothioate |
| SMILES | CN(C)C(=O)Sc1c(N)cc(F)cc1Cl |
| InChI | InChI=1S/C9H10ClFN2OS/c1-13(2)9(14)15-8-6(10)3-5(11)4-7(8)12/h3-4H,12H2,1-2H3 |
| InChIKey | NQXDSALUBNHNBJ-UHFFFAOYSA-N |
| XLogP | 2.84 |
| TPSA | 46.33 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 15 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 248.71 |
| LogP ≤ 5 | 2.84 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'aniline', 'substructure': 'N/A'}, {'alert_name': 'thioester', 'substructure': 'N/A'} |
|---|