C18H23IN4O — CID 14810820
5-(1,1-dimethylpiperidin-1-ium-4-yl)-3-(1-methylindol-3-yl)-1,2,4-oxadiazole iodide (PubChem CID 14810820) has the molecular formula C18H23IN4O and a molecular weight of 438.31 g/mol. Its IUPAC name is 5-(1,1-dimethylpiperidin-1-ium-4-yl)-3-(1-methylindol-3-yl)-1,2,4-oxadiazole iodide.
| Compound Name | 5-(1,1-dimethylpiperidin-1-ium-4-yl)-3-(1-methylindol-3-yl)-1,2,4-oxadiazole iodide |
|---|---|
| PubChem CID | 14810820 |
| Molecular Formula | C18H23IN4O |
| Molecular Weight | 438.31 g/mol |
| Exact Mass | 438.09 |
| IUPAC Name | 5-(1,1-dimethylpiperidin-1-ium-4-yl)-3-(1-methylindol-3-yl)-1,2,4-oxadiazole iodide |
| SMILES | Cn1cc(-c2noc(C3CC[N+](C)(C)CC3)n2)c2ccccc21.[I-] |
| InChI | InChI=1S/C18H23N4O.HI/c1-21-12-15(14-6-4-5-7-16(14)21)17-19-18(23-20-17)13-8-10-22(2,3)11-9-13;/h4-7,12-13H,8-11H2,1-3H3;1H/q+1;/p-1 |
| InChIKey | CGOMZJASWVSSTK-UHFFFAOYSA-M |
| XLogP | 0.19 |
| TPSA | 43.85 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 438.31 |
| LogP ≤ 5 | 0.19 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'iodine', 'substructure': 'N/A'}, {'alert_name': 'quaternary_nitrogen_2', 'substructure': 'N/A'} |
|---|