About 2-ethenyl-1,7,7-trimethylbicyclo[2.2.1]heptan-2-ol
2-ethenyl-1,7,7-trimethylbicyclo[2.2.1]heptan-2-ol (PubChem CID 14811557) has the molecular formula C12H20O
and a molecular weight of 180.29 g/mol. Its IUPAC name is 2-ethenyl-1,7,7-trimethylbicyclo[2.2.1]heptan-2-ol.
Molecular Properties
| Compound Name | 2-ethenyl-1,7,7-trimethylbicyclo[2.2.1]heptan-2-ol |
| PubChem CID | 14811557 |
| Molecular Formula | C12H20O |
| Molecular Weight | 180.29 g/mol |
| Exact Mass | 180.15 |
| IUPAC Name | 2-ethenyl-1,7,7-trimethylbicyclo[2.2.1]heptan-2-ol |
| SMILES | C=CC1(O)CC2CCC1(C)C2(C)C |
| InChI | InChI=1S/C12H20O/c1-5-12(13)8-9-6-7-11(12,4)10(9,2)3/h5,9,13H,1,6-8H2,2-4H3 |
| InChIKey | GCIUUXWWELOLLP-UHFFFAOYSA-N |
| XLogP | 2.75 |
| TPSA | 20.23 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 13 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 180.29 |
| LogP ≤ 5 | 2.75 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 1 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|
Analyze 2-ethenyl-1,7,7-trimethylbicyclo[2.2.1]heptan-2-ol with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 2-ethenyl-1,7,7-trimethylbicyclo[2.2.1]heptan-2-ol?
The IUPAC name of 2-ethenyl-1,7,7-trimethylbicyclo[2.2.1]heptan-2-ol (CID 14811557) is 2-ethenyl-1,7,7-trimethylbicyclo[2.2.1]heptan-2-ol.
What is the SMILES notation for 2-ethenyl-1,7,7-trimethylbicyclo[2.2.1]heptan-2-ol?
The canonical SMILES for 2-ethenyl-1,7,7-trimethylbicyclo[2.2.1]heptan-2-ol is C=CC1(O)CC2CCC1(C)C2(C)C.
What is the InChIKey of 2-ethenyl-1,7,7-trimethylbicyclo[2.2.1]heptan-2-ol?
The InChIKey is GCIUUXWWELOLLP-UHFFFAOYSA-N. The full InChI is InChI=1S/C12H20O/c1-5-12(13)8-9-6-7-11(12,4)10(9,2)3/h5,9,13H,1,6-8H2,2-4H3.
What are the key properties of 2-ethenyl-1,7,7-trimethylbicyclo[2.2.1]heptan-2-ol?
2-ethenyl-1,7,7-trimethylbicyclo[2.2.1]heptan-2-ol has a molecular weight of 180.29 g/mol, XLogP of 2.75, 1 rotatable bonds, 1 hydrogen bond donors, and 1 hydrogen bond acceptors.
Where does this data come from?
All data for 2-ethenyl-1,7,7-trimethylbicyclo[2.2.1]heptan-2-ol is sourced from PubChem (CID 14811557), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).