C12H16N4O3 — CID 1481169
(2R)-2-(5-cyano-2,4-dioxopyrimidin-1-yl)-N,3,3-trimethylbutanamide (PubChem CID 1481169) has the molecular formula C12H16N4O3 and a molecular weight of 264.28 g/mol. Its IUPAC name is (2R)-2-(5-cyano-2,4-dioxopyrimidin-1-yl)-N,3,3-trimethylbutanamide.
| Compound Name | (2R)-2-(5-cyano-2,4-dioxopyrimidin-1-yl)-N,3,3-trimethylbutanamide |
|---|---|
| PubChem CID | 1481169 |
| Molecular Formula | C12H16N4O3 |
| Molecular Weight | 264.28 g/mol |
| Exact Mass | 264.12 |
| IUPAC Name | (2R)-2-(5-cyano-2,4-dioxopyrimidin-1-yl)-N,3,3-trimethylbutanamide |
| SMILES | CNC(=O)[C@H](n1cc(C#N)c(=O)[nH]c1=O)C(C)(C)C |
| InChI | InChI=1S/C12H16N4O3/c1-12(2,3)8(10(18)14-4)16-6-7(5-13)9(17)15-11(16)19/h6,8H,1-4H3,(H,14,18)(H,15,17,19)/t8-/m0/s1 |
| InChIKey | GMFMXAJTPWAJDZ-QMMMGPOBSA-N |
| XLogP | -0.26 |
| TPSA | 107.75 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 264.28 |
| LogP ≤ 5 | -0.26 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |