C11H21NO — CID 14811802
1,2,2,3,6,6-hexamethylpiperidin-4-one (PubChem CID 14811802) has the molecular formula C11H21NO and a molecular weight of 183.29 g/mol. Its IUPAC name is 1,2,2,3,6,6-hexamethylpiperidin-4-one.
| Compound Name | 1,2,2,3,6,6-hexamethylpiperidin-4-one |
|---|---|
| PubChem CID | 14811802 |
| Molecular Formula | C11H21NO |
| Molecular Weight | 183.29 g/mol |
| Exact Mass | 183.16 |
| IUPAC Name | 1,2,2,3,6,6-hexamethylpiperidin-4-one |
| SMILES | CC1C(=O)CC(C)(C)N(C)C1(C)C |
| InChI | InChI=1S/C11H21NO/c1-8-9(13)7-10(2,3)12(6)11(8,4)5/h8H,7H2,1-6H3 |
| InChIKey | PROIHOMJIRIGBH-UHFFFAOYSA-N |
| XLogP | 2.08 |
| TPSA | 20.31 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | |
| Heavy Atoms | 13 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 183.29 |
| LogP ≤ 5 | 2.08 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |