C12H23NO — CID 14811804
1,2,2,3,5,6,6-heptamethylpiperidin-4-one (PubChem CID 14811804) has the molecular formula C12H23NO and a molecular weight of 197.32 g/mol. Its IUPAC name is 1,2,2,3,5,6,6-heptamethylpiperidin-4-one.
| Compound Name | 1,2,2,3,5,6,6-heptamethylpiperidin-4-one |
|---|---|
| PubChem CID | 14811804 |
| Molecular Formula | C12H23NO |
| Molecular Weight | 197.32 g/mol |
| Exact Mass | 197.18 |
| IUPAC Name | 1,2,2,3,5,6,6-heptamethylpiperidin-4-one |
| SMILES | CC1C(=O)C(C)C(C)(C)N(C)C1(C)C |
| InChI | InChI=1S/C12H23NO/c1-8-10(14)9(2)12(5,6)13(7)11(8,3)4/h8-9H,1-7H3 |
| InChIKey | RYKKSSSXUVARHB-UHFFFAOYSA-N |
| XLogP | 2.33 |
| TPSA | 20.31 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | |
| Heavy Atoms | 14 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 197.32 |
| LogP ≤ 5 | 2.33 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |