(2S,5R)-5-hydroxy-1,3-oxathiolane-2-carboxylic acid

C4H6O4S — CID 1481202

IUPAC(2S,5R)-5-hydroxy-1,3-oxathiolane-2-carboxylic acid
SMILESO=C(O)[C@H]1O[C@@H](O)CS1
InChIInChI=1S/C4H6O4S/c5-2-1-9-4(8-2)3(6)7/h2,4-5H,1H2,(H,6,7)/t2-,4+/m1/s1
InChIKeyLOWHAEXKCMFUMV-FONMRSAGSA-N
MW150.15 g/mol
LogP-0.52
Rot. Bonds1

About (2S,5R)-5-hydroxy-1,3-oxathiolane-2-carboxylic acid

(2S,5R)-5-hydroxy-1,3-oxathiolane-2-carboxylic acid (PubChem CID 1481202) has the molecular formula C4H6O4S and a molecular weight of 150.15 g/mol. Its IUPAC name is (2S,5R)-5-hydroxy-1,3-oxathiolane-2-carboxylic acid.

Molecular Properties

Compound Name(2S,5R)-5-hydroxy-1,3-oxathiolane-2-carboxylic acid
PubChem CID1481202
Molecular FormulaC4H6O4S
Molecular Weight150.15 g/mol
Exact Mass150.00
IUPAC Name(2S,5R)-5-hydroxy-1,3-oxathiolane-2-carboxylic acid
SMILESO=C(O)[C@H]1O[C@@H](O)CS1
InChIInChI=1S/C4H6O4S/c5-2-1-9-4(8-2)3(6)7/h2,4-5H,1H2,(H,6,7)/t2-,4+/m1/s1
InChIKeyLOWHAEXKCMFUMV-FONMRSAGSA-N
XLogP-0.52
TPSA66.76 Ų
H-Bond Donors2
H-Bond Acceptors4
Rotatable Bonds1
Heavy Atoms9
Complexity

Lipinski Rule of Five

Passes Rule of Five

RuleValue
MW ≤ 500150.15
LogP ≤ 5-0.52
H-Bond Donors ≤ 52
H-Bond Acceptors ≤ 104

Analyze (2S,5R)-5-hydroxy-1,3-oxathiolane-2-carboxylic acid with MolForge

Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.

Launch Full Analysis

Frequently Asked Questions

What is the IUPAC name of (2S,5R)-5-hydroxy-1,3-oxathiolane-2-carboxylic acid?
The IUPAC name of (2S,5R)-5-hydroxy-1,3-oxathiolane-2-carboxylic acid (CID 1481202) is (2S,5R)-5-hydroxy-1,3-oxathiolane-2-carboxylic acid.
What is the SMILES notation for (2S,5R)-5-hydroxy-1,3-oxathiolane-2-carboxylic acid?
The canonical SMILES for (2S,5R)-5-hydroxy-1,3-oxathiolane-2-carboxylic acid is O=C(O)[C@H]1O[C@@H](O)CS1.
What is the InChIKey of (2S,5R)-5-hydroxy-1,3-oxathiolane-2-carboxylic acid?
The InChIKey is LOWHAEXKCMFUMV-FONMRSAGSA-N. The full InChI is InChI=1S/C4H6O4S/c5-2-1-9-4(8-2)3(6)7/h2,4-5H,1H2,(H,6,7)/t2-,4+/m1/s1.
What are the key properties of (2S,5R)-5-hydroxy-1,3-oxathiolane-2-carboxylic acid?
(2S,5R)-5-hydroxy-1,3-oxathiolane-2-carboxylic acid has a molecular weight of 150.15 g/mol, XLogP of -0.52, 1 rotatable bonds, 2 hydrogen bond donors, and 4 hydrogen bond acceptors.
Where does this data come from?
All data for (2S,5R)-5-hydroxy-1,3-oxathiolane-2-carboxylic acid is sourced from PubChem (CID 1481202), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).